EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:28785 - (+)-ureidoglycolic acid
| Formula | C3H6N2O4 |
| Net Charge | 0 |
| Average Mass | 134.091 |
| Monoisotopic Mass | 134.03276 |
| SMILES | NC(=O)N[C@H](O)C(=O)O |
| InChI | InChI=1S/C3H6N2O4/c4-3(9)5-1(6)2(7)8/h1,6H,(H,7,8)(H3,4,5,9)/t1-/m1/s1 |
| InChIKey | NWZYYCVIOKVTII-PVQJCKRUSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | Saccharomyces cerevisiae metabolite Any fungal metabolite produced during a metabolic reaction in Baker's yeast (Saccharomyces cerevisiae ). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (+)-ureidoglycolic acid (CHEBI:28785) is a ureidoglycolic acid (CHEBI:49050) |
| (+)-ureidoglycolic acid (CHEBI:28785) is enantiomer of (−)-ureidoglycolic acid (CHEBI:15412) |
| Incoming Relation(s) |
| (−)-ureidoglycolic acid (CHEBI:15412) is enantiomer of (+)-ureidoglycolic acid (CHEBI:28785) |
| IUPAC Name |
|---|
| (2R)-(carbamoylamino)(hydroxy)acetic acid |
| Synonyms | Source |
|---|---|
| (+)-Ureidoglycolate | KEGG COMPOUND |
| (R)-Ureidoglycolate | KEGG COMPOUND |
| (+)-ureidoglycolate | ChEBI |