EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:15582 - (2R,3S)-2,3-dimethylmalic acid
| Formula | C6H10O5 |
| Net Charge | 0 |
| Average Mass | 162.141 |
| Monoisotopic Mass | 162.05282 |
| SMILES | C[C@H](C(=O)O)[C@@](C)(O)C(=O)O |
| InChI | InChI=1S/C6H10O5/c1-3(4(7)8)6(2,11)5(9)10/h3,11H,1-2H3,(H,7,8)(H,9,10)/t3-,6-/m1/s1 |
| InChIKey | WTIIULQJLZEHGZ-AWFVSMACSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (2R,3S)-2,3-dimethylmalic acid (CHEBI:15582) is a 2,3-dimethylmalic acid (CHEBI:15590) |
| (2R,3S)-2,3-dimethylmalic acid (CHEBI:15582) is a dicarboxylic fatty acid (CHEBI:189840) |
| (2R,3S)-2,3-dimethylmalic acid (CHEBI:15582) is conjugate acid of (2R,3S)-2,3-dimethylmalate(2−) (CHEBI:57422) |
| Incoming Relation(s) |
| (2R,3S)-2,3-dimethylmalate(2−) (CHEBI:57422) is conjugate base of (2R,3S)-2,3-dimethylmalic acid (CHEBI:15582) |
| IUPAC Name |
|---|
| (2R,3S)-2-hydroxy-2,3-dimethylbutanedioic acid |
| Synonyms | Source |
|---|---|
| (2R,3S)-2,3-Dimethylmalate | KEGG COMPOUND |
| (2R,3S)-2,3-dimethylmalate | ChEBI |
| Citations |
|---|