EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C33H37F2N7O4 |
| Net Charge | 0 |
| Average Mass | 633.700 |
| Monoisotopic Mass | 633.28751 |
| SMILES | CN1CCN(C2CCN(C(=O)Nc3cc(Oc4ccc(NC(=O)C5(C(=O)Nc6ccc(F)cc6)CC5)c(F)c4)ccn3)CC2)CC1 |
| InChI | InChI=1S/C33H37F2N7O4/c1-40-16-18-41(19-17-40)24-9-14-42(15-10-24)32(45)39-29-21-26(8-13-36-29)46-25-6-7-28(27(35)20-25)38-31(44)33(11-12-33)30(43)37-23-4-2-22(34)3-5-23/h2-8,13,20-21,24H,9-12,14-19H2,1H3,(H,37,43)(H,38,44)(H,36,39,45) |
| InChIKey | UQRCJCNVNUFYDX-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Sus scrofa (ncbitaxon:9823) | sausage (ENVO:00002166) | MetaboLights (MTBLS2871) |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Golvatinib (CHEBI:177746) has role antineoplastic agent (CHEBI:35610) |
| Golvatinib (CHEBI:177746) is a aromatic ether (CHEBI:35618) |
| Golvatinib (CHEBI:177746) is a organic molecular entity (CHEBI:50860) |
| IUPAC Name |
|---|
| 1-N'-[2-luoro-4-[2-[[4-(4-methylpiperazin-1-yl)piperidine-1-carbonyl]amino]pyridin-4-yl]oxyphenyl]-1-N-(4-luorophenyl)cyclopropane-1,1-dicarboxamide |
| INN | Source |
|---|---|
| golvatinib | WHO MedNet |
| Synonyms | Source |
|---|---|
| E-7050 | ChEMBL |
| E7050 | ChEMBL |
| Citations |
|---|