EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C2H4O2S |
| Net Charge | 0 |
| Average Mass | 92.119 |
| Monoisotopic Mass | 91.99320 |
| SMILES | O=C(O)CS |
| InChI | InChI=1S/C2H4O2S/c3-2(4)1-5/h5H,1H2,(H,3,4) |
| InChIKey | CWERGRDVMFNCDR-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| thioglycolic acid (CHEBI:30065) is a sulfur-containing carboxylic acid (CHEBI:33576) |
| thioglycolic acid (CHEBI:30065) is conjugate acid of thioglycolate(1−) (CHEBI:30066) |
| Incoming Relation(s) |
| (methylthio)acetic acid (CHEBI:47870) has functional parent thioglycolic acid (CHEBI:30065) |
| thioglycolate ester (CHEBI:48619) has functional parent thioglycolic acid (CHEBI:30065) |
| thioglycolate(1−) (CHEBI:30066) is conjugate base of thioglycolic acid (CHEBI:30065) |
| IUPAC Name |
|---|
| sulfanylacetic acid |
| Synonyms | Source |
|---|---|
| 2-mercaptoacetic acid | ChemIDplus |
| 2-thioglycolic acid | ChemIDplus |
| Mercaptoacetic acid | KEGG COMPOUND |
| Mercaptoessigsäure | ChEBI |
| Mercaptoethanoic acid | KEGG COMPOUND |
| Merkaptoessigsäure | ChEBI |
| Citations |
|---|