EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H6O6 |
| Net Charge | 0 |
| Average Mass | 198.130 |
| Monoisotopic Mass | 198.01644 |
| SMILES | O=C(O)c1cc(O)c(O)cc1C(=O)O |
| InChI | InChI=1S/C8H6O6/c9-5-1-3(7(11)12)4(8(13)14)2-6(5)10/h1-2,9-10H,(H,11,12)(H,13,14) |
| InChIKey | YZBCICVNBHNLTK-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4,5-dihydroxyphthalic acid (CHEBI:17199) has functional parent phthalic acid (CHEBI:29069) |
| 4,5-dihydroxyphthalic acid (CHEBI:17199) is a hydroxybenzoic acid (CHEBI:24676) |
| 4,5-dihydroxyphthalic acid (CHEBI:17199) is conjugate acid of 4,5-dihydroxyphthalate(2−) (CHEBI:58051) |
| Incoming Relation(s) |
| 4,5-dihydroxyphthalate(2−) (CHEBI:58051) is conjugate base of 4,5-dihydroxyphthalic acid (CHEBI:17199) |
| IUPAC Name |
|---|
| 4,5-dihydroxyphthalic acid |
| Synonyms | Source |
|---|---|
| 4,5-Dihydroxyphthalate | KEGG COMPOUND |
| 4,5-Dihydroxyphthalic acid | KEGG COMPOUND |