EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H4NO6P |
| Net Charge | -2 |
| Average Mass | 217.073 |
| Monoisotopic Mass | 216.97872 |
| SMILES | O=[N+]([O-])c1ccc(OP(=O)([O-])[O-])cc1 |
| InChI | InChI=1S/C6H6NO6P/c8-7(9)5-1-3-6(4-2-5)13-14(10,11)12/h1-4H,(H2,10,11,12)/p-2 |
| InChIKey | XZKIHKMTEMTJQX-UHFFFAOYSA-L |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | DOI (10.1038/nbt.2488) |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-nitrophenyl phosphate(2−) (CHEBI:61146) is a organophosphate oxoanion (CHEBI:58945) |
| 4-nitrophenyl phosphate(2−) (CHEBI:61146) is conjugate base of 4-nitrophenyl phosphate (CHEBI:17440) |
| Incoming Relation(s) |
| 4-nitrophenyl phosphate (CHEBI:17440) is conjugate acid of 4-nitrophenyl phosphate(2−) (CHEBI:61146) |
| IUPAC Name |
|---|
| 4-nitrophenyl phosphate |
| Synonyms | Source |
|---|---|
| 4-nitrophenyl phosphate dianion | ChEBI |
| p-nitrophenyl phosphate | ChEBI |
| p-nitrophenyl phosphate(2−) | ChEBI |
| p-nitrophenyl phosphate dianion | ChEBI |
| mono(4-nitrophenyl)phosphate(2−) | ChEBI |
| mono(4-nitrophenyl)phosphate dianion | ChEBI |
| UniProt Name | Source |
|---|---|
| 4-nitrophenyl phosphate | UniProt |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3680906 | Reaxys |