EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H10O2 |
| Net Charge | 0 |
| Average Mass | 162.188 |
| Monoisotopic Mass | 162.06808 |
| SMILES | O[C@H]1C=Cc2ccccc2[C@@H]1O |
| InChI | InChI=1S/C10H10O2/c11-9-6-5-7-3-1-2-4-8(7)10(9)12/h1-6,9-12H/t9-,10-/m0/s1 |
| InChIKey | QPUHWUSUBHNZCG-UWVGGRQHSA-N |
| Roles Classification |
|---|
| Biological Roles: | mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). bacterial xenobiotic metabolite Any bacterial metabolite produced by metabolism of a xenobiotic compound in bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (1S,2S)-1,2-dihydronaphthalene-1,2-diol (CHEBI:28809) is a trans-1,2-dihydronaphthalene-1,2-diol (CHEBI:27039) |
| (1S,2S)-1,2-dihydronaphthalene-1,2-diol (CHEBI:28809) is enantiomer of (1R,2R)-1,2-dihydronaphthalene-1,2-diol (CHEBI:38140) |
| Incoming Relation(s) |
| (1R,2R)-1,2-dihydronaphthalene-1,2-diol (CHEBI:38140) is enantiomer of (1S,2S)-1,2-dihydronaphthalene-1,2-diol (CHEBI:28809) |
| IUPAC Name |
|---|
| (1S,2S)-1,2-dihydronaphthalene-1,2-diol |
| Synonyms | Source |
|---|---|
| (1S,2S)-1,2-dihydroxy-1,2-dihydronaphthalene | ChEBI |
| (1S,2S)-1,2-Dihydronaphthalene-1,2-diol | KEGG COMPOUND |
| UniProt Name | Source |
|---|---|
| (1S,2S)-1,2-dihydronaphthalene-1,2-diol | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C04514 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1909467 | Reaxys |