EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:16116 - 3-hydroxy-4-methylanthranilic acid
| Formula | C8H9NO3 |
| Net Charge | 0 |
| Average Mass | 167.164 |
| Monoisotopic Mass | 167.05824 |
| SMILES | Cc1ccc(C(=O)O)c(N)c1O |
| InChI | InChI=1S/C8H9NO3/c1-4-2-3-5(8(11)12)6(9)7(4)10/h2-3,10H,9H2,1H3,(H,11,12) |
| InChIKey | OYZONAXDAWHDMN-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces anulatus (ncbitaxon:1892) | - | PubMed (23423168) | |
| Streptomyces parvulus (ncbitaxon:146923) | - | PubMed (23423168) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-hydroxy-4-methylanthranilic acid (CHEBI:16116) has functional parent anthranilic acid (CHEBI:30754) |
| 3-hydroxy-4-methylanthranilic acid (CHEBI:16116) has role bacterial metabolite (CHEBI:76969) |
| 3-hydroxy-4-methylanthranilic acid (CHEBI:16116) is a aminobenzoic acid (CHEBI:22495) |
| 3-hydroxy-4-methylanthranilic acid (CHEBI:16116) is a monohydroxybenzoic acid (CHEBI:25389) |
| 3-hydroxy-4-methylanthranilic acid (CHEBI:16116) is conjugate acid of 3-hydroxy-4-methylanthranilate (CHEBI:36558) |
| Incoming Relation(s) |
| 2-amino-3-hydroxy-4-methylbenzoyl-AMP (CHEBI:112505) has functional parent 3-hydroxy-4-methylanthranilic acid (CHEBI:16116) |
| 3-hydroxy-4-methylanthranilate (CHEBI:36558) is conjugate base of 3-hydroxy-4-methylanthranilic acid (CHEBI:16116) |
| IUPAC Name |
|---|
| 2-amino-3-hydroxy-4-methylbenzoic acid |
| Synonyms | Source |
|---|---|
| 4-Methyl-3-hydroxyanthranilic acid | ChemIDplus |
| 3,4-Cresotic acid, 2-amino- | ChemIDplus |
| Citations |
|---|