EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H25NO4 |
| Net Charge | 0 |
| Average Mass | 355.434 |
| Monoisotopic Mass | 355.17836 |
| SMILES | [H][C@@]12Cc3ccc(OC)c(OC)c3CN1CCc1cc(OC)c(OC)cc12 |
| InChI | InChI=1S/C21H25NO4/c1-23-18-6-5-13-9-17-15-11-20(25-3)19(24-2)10-14(15)7-8-22(17)12-16(13)21(18)26-4/h5-6,10-11,17H,7-9,12H2,1-4H3/t17-/m0/s1 |
| InChIKey | AEQDJSLRWYMAQI-KRWDZBQOSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | adrenergic agent Any agent that acts on an adrenergic receptor or affects the life cycle of an adrenergic transmitter. dopaminergic antagonist A drug that binds to but does not activate dopamine receptors, thereby blocking the actions of dopamine or exogenous agonists. non-narcotic analgesic A drug that has principally analgesic, antipyretic and anti-inflammatory actions. Non-narcotic analgesics do not bind to opioid receptors. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Applications: | adrenergic agent Any agent that acts on an adrenergic receptor or affects the life cycle of an adrenergic transmitter. dopaminergic antagonist A drug that binds to but does not activate dopamine receptors, thereby blocking the actions of dopamine or exogenous agonists. non-narcotic analgesic A drug that has principally analgesic, antipyretic and anti-inflammatory actions. Non-narcotic analgesics do not bind to opioid receptors. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tetrahydropalmatine (CHEBI:16563) has functional parent palmatine (CHEBI:16096) |
| tetrahydropalmatine (CHEBI:16563) has role adrenergic agent (CHEBI:37962) |
| tetrahydropalmatine (CHEBI:16563) has role dopaminergic antagonist (CHEBI:48561) |
| tetrahydropalmatine (CHEBI:16563) has role non-narcotic analgesic (CHEBI:35481) |
| tetrahydropalmatine (CHEBI:16563) is a an (S)-7,8,13,14-tetrahydroprotoberberine (CHEBI:194528) |
| tetrahydropalmatine (CHEBI:16563) is a berberine alkaloid (CHEBI:22754) |
| tetrahydropalmatine (CHEBI:16563) is a organic heterotetracyclic compound (CHEBI:38163) |
| IUPAC Name |
|---|
| (13aS)-2,3,9,10-tetramethoxy-5,8,13,13a-tetrahydro-6H-isoquino[3,2-a]isoquinoline |
| Synonyms | Source |
|---|---|
| 2,3,9,10-tetramethoxy-13aα-berbine | ChemIDplus |
| (S)-(−)-tetrahydropalmatine | ChEBI |
| (S)-tetrahydropalmatine | ChemIDplus |
| L-tetrahydropalmatine | ChEBI |
| (S)-Tetrahydropalmatine | KEGG COMPOUND |
| (−)-tetrahydropalmatine | ChemIDplus |
| UniProt Name | Source |
|---|---|
| (S)-tetrahydropalmatine | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C00025252 | KNApSAcK |
| C02890 | KEGG COMPOUND |
| Tetrahydropalmatine | Wikipedia |
| TETRAHYDROPALMATINE | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| Reaxys:96288 | Reaxys |
| CAS:483-14-7 | KEGG COMPOUND |
| CAS:483-14-7 | ChemIDplus |
| Citations |
|---|