EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H40N7O19P3S |
| Net Charge | 0 |
| Average Mass | 867.614 |
| Monoisotopic Mass | 867.13125 |
| SMILES | CC(C)(COP(=O)(O)OP(=O)(O)OC[C@H]1O[C@@H](n2cnc3c(N)ncnc32)[C@H](O)[C@@H]1OP(=O)(O)O)[C@@H](O)C(=O)NCCC(=O)NCCSC(=O)CCC(=O)O |
| InChI | InChI=1S/C25H40N7O19P3S/c1-25(2,20(38)23(39)28-6-5-14(33)27-7-8-55-16(36)4-3-15(34)35)10-48-54(45,46)51-53(43,44)47-9-13-19(50-52(40,41)42)18(37)24(49-13)32-12-31-17-21(26)29-11-30-22(17)32/h11-13,18-20,24,37-38H,3-10H2,1-2H3,(H,27,33)(H,28,39)(H,34,35)(H,43,44)(H,45,46)(H2,26,29,30)(H2,40,41,42)/t13-,18-,19-,20+,24-/m1/s1 |
| InChIKey | VNOYUJKHFWYWIR-ITIYDSSPSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Escherichia coli (ncbitaxon:562) | - | PubMed (21988831) | |
| Mus musculus (ncbitaxon:10090) | - | PubMed (19425150) | Source: BioModels - MODEL1507180067 |
| Roles Classification |
|---|
| Chemical Role: | acyl donor Any donor that can transfer acyl groups between molecular entities. |
| Biological Roles: | Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). inhibitor A substance that diminishes the rate of a chemical reaction. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| succinyl-CoA (CHEBI:15380) has functional parent coenzyme A (CHEBI:15346) |
| succinyl-CoA (CHEBI:15380) has role Escherichia coli metabolite (CHEBI:76971) |
| succinyl-CoA (CHEBI:15380) has role inhibitor (CHEBI:35222) |
| succinyl-CoA (CHEBI:15380) has role mouse metabolite (CHEBI:75771) |
| succinyl-CoA (CHEBI:15380) is a ω-carboxyacyl-CoA (CHEBI:37555) |
| succinyl-CoA (CHEBI:15380) is conjugate acid of succinyl-CoA(5−) (CHEBI:57292) |
| Incoming Relation(s) |
| succinyl-CoA sodium salt (CHEBI:233981) has part succinyl-CoA (CHEBI:15380) |
| succinyl-CoA(5−) (CHEBI:57292) is conjugate base of succinyl-CoA (CHEBI:15380) |
| IUPAC Name |
|---|
| 3'-phosphoadenosine 5'-{3-[(3R)-4-{[3-({2-[(3-carboxypropanoyl)sulfanyl]ethyl}amino)-3-oxopropyl]amino}-3-hydroxy-2,2-dimethyl-4-oxobutyl] dihydrogen diphosphate} |
| Synonyms | Source |
|---|---|
| Coenzyme A, S-(hydrogen butanedioate) | ChemIDplus |
| S-(3-carboxy-propionyl)-CoA | ChEBI |
| S-(3-Carboxy-propionyl)-coenzym-A | ChEBI |
| S-(3-carboxypropionyl)-coenzyme-A | ChEBI |
| S-(hydrogen succinyl)-CoA | ChEBI |
| S-(Hydrogen succinyl)coenzyme A | ChemIDplus |
| Citations |
|---|