EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H9O5 |
| Net Charge | -1 |
| Average Mass | 173.144 |
| Monoisotopic Mass | 173.04555 |
| SMILES | O=C([O-])C1=C[C@@H](O)[C@@H](O)[C@H](O)C1 |
| InChI | InChI=1S/C7H10O5/c8-4-1-3(7(11)12)2-5(9)6(4)10/h1,4-6,8-10H,2H2,(H,11,12)/p-1/t4-,5-,6-/m1/s1 |
| InChIKey | JXOHGGNKMLTUBP-HSUXUTPPSA-M |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Escherichia coli (ncbitaxon:562) | - | PubMed (24783849) | |
| Saccharomyces cerevisiae (ncbitaxon:4932) | |||
| - | PubMed (24981409) | ||
| - | PubMed (24678285) | Source: yeast.sf.net |
| Roles Classification |
|---|
| Biological Roles: | Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. Saccharomyces cerevisiae metabolite Any fungal metabolite produced during a metabolic reaction in Baker's yeast (Saccharomyces cerevisiae ). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| shikimate (CHEBI:36208) has role Escherichia coli metabolite (CHEBI:76971) |
| shikimate (CHEBI:36208) has role Saccharomyces cerevisiae metabolite (CHEBI:75772) |
| shikimate (CHEBI:36208) has role plant metabolite (CHEBI:76924) |
| shikimate (CHEBI:36208) is a cyclohexenecarboxylate (CHEBI:36126) |
| shikimate (CHEBI:36208) is a hydroxy monocarboxylic acid anion (CHEBI:36059) |
| shikimate (CHEBI:36208) is conjugate base of shikimic acid (CHEBI:16119) |
| Incoming Relation(s) |
| 3-dehydroshikimate (CHEBI:16630) has functional parent shikimate (CHEBI:36208) |
| 3-phosphonatoshikimate(3−) (CHEBI:145989) has functional parent shikimate (CHEBI:36208) |
| 5-deoxy-5-aminoshikimic acid zwitterion (CHEBI:194198) has functional parent shikimate (CHEBI:36208) |
| shikimic acid (CHEBI:16119) is conjugate acid of shikimate (CHEBI:36208) |
| IUPAC Name |
|---|
| (3R,4S,5R)--3,4,5-trihydroxycyclohex-1-ene-1-carboxylate |
| UniProt Name | Source |
|---|---|
| shikimate | UniProt |