EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H32O16 |
| Net Charge | 0 |
| Average Mass | 504.438 |
| Monoisotopic Mass | 504.16903 |
| SMILES | OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO)O[C@H](CO)[C@@H](O)[C@@H]3O)[C@H](O)[C@@H](O)[C@@H]2O)[C@H](O)[C@@H](O)[C@H]1O |
| WURCS | WURCS=2.0/3,3,2/[a2122h-1a_1-5][ha122h-2b_2-5][a2112h-1a_1-5]/1-2-3/a1-b2_a6-c1 |
| InChI | InChI=1S/C18H32O16/c19-1-5-8(22)11(25)13(27)16(31-5)30-3-7-9(23)12(26)14(28)17(32-7)34-18(4-21)15(29)10(24)6(2-20)33-18/h5-17,19-29H,1-4H2/t5-,6-,7-,8+,9-,10-,11+,12+,13-,14-,15+,16+,17-,18+/m1/s1 |
| InChIKey | MUPFEKGTMRGPLJ-ZQSKZDJDSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | - | PubMed (19425150) | Source: BioModels - MODEL1507180067 |
| Saccharomyces cerevisiae (ncbitaxon:4932) | - | PubMed (24678285) | Source: yeast.sf.net |
| Roles Classification |
|---|
| Biological Roles: | Saccharomyces cerevisiae metabolite Any fungal metabolite produced during a metabolic reaction in Baker's yeast (Saccharomyces cerevisiae ). mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| raffinose (CHEBI:16634) has role Saccharomyces cerevisiae metabolite (CHEBI:75772) |
| raffinose (CHEBI:16634) has role mouse metabolite (CHEBI:75771) |
| raffinose (CHEBI:16634) has role plant metabolite (CHEBI:76924) |
| raffinose (CHEBI:16634) is a raffinose family oligosaccharide (CHEBI:74961) |
| raffinose (CHEBI:16634) is a trisaccharide (CHEBI:27150) |
| Incoming Relation(s) |
| 1F-α-D-galactosylraffinose (CHEBI:27603) has functional parent raffinose (CHEBI:16634) |
| stachyose (CHEBI:17164) has functional parent raffinose (CHEBI:16634) |
| IUPAC Name |
|---|
| β-D-fructofuranosyl α-D-galactopyranosyl-(1→6)-α-D-glucopyranoside |
| Synonyms | Source |
|---|---|
| 6G-alpha-D-galactosylsucrose | KEGG COMPOUND |
| Gossypose | KEGG COMPOUND |
| Melitose | KEGG COMPOUND |
| Melitriose | KEGG COMPOUND |
| Raffinose | KEGG COMPOUND |
| rafinose | ChEBI |
| UniProt Name | Source |
|---|---|
| raffinose | UniProt |
| Citations |
|---|