EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C44H52N4O17 |
| Net Charge | 0 |
| Average Mass | 908.911 |
| Monoisotopic Mass | 908.33275 |
| SMILES | CC(=O)C12N/C(=C\C3=NC(=C(CCC(=O)O)[C@]3(C)CC(=O)O)Cc3nc(c(CCC(=O)O)c3CC(=O)O)CC3=NC1=C(CC(=O)O)[C@@]3(C)CCC(=O)O)[C@@H](CCC(=O)O)[C@]2(C)CC(=O)O |
| InChI | InChI=1S/C44H52N4O17/c1-20(49)44-40-25(14-37(60)61)41(2,12-11-35(56)57)30(47-40)16-27-21(5-8-32(50)51)22(13-36(58)59)26(45-27)15-28-23(6-9-33(52)53)42(3,18-38(62)63)31(46-28)17-29(48-44)24(7-10-34(54)55)43(44,4)19-39(64)65/h17,24,45,48H,5-16,18-19H2,1-4H3,(H,50,51)(H,52,53)(H,54,55)(H,56,57)(H,58,59)(H,60,61)(H,62,63)(H,64,65)/b29-17-/t24-,41-,42+,43+,44?/m1/s1 |
| InChIKey | IOBDBIPWYQGVMM-VLMJWMIZSA-N |
| Roles Classification |
|---|
| Biological Role: | cofactor An organic molecule or ion (usually a metal ion) that is required by an enzyme for its activity. It may be attached either loosely (coenzyme) or tightly (prosthetic group). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| precorrin-4 (CHEBI:16430) is a precorrin (CHEBI:26228) |
| precorrin-4 (CHEBI:16430) is conjugate acid of precorrin-4(8−) (CHEBI:57769) |
| Incoming Relation(s) |
| cobalt-precorrin-4 (CHEBI:3792) has functional parent precorrin-4 (CHEBI:16430) |
| precorrin-4(8−) (CHEBI:57769) is conjugate base of precorrin-4 (CHEBI:16430) |
| IUPAC Name |
|---|
| 3,3',3'',3'''-[(2S,3S,7S,17R)-1-acetyl-2,7,12,18-tetrakis(carboxymethyl)-2,7,17-trimethyl-18,19-didehydrocorrin-3,8,13,17-tetrayl]tetrapropanoic acid |
| Synonyms | Source |
|---|---|
| Precorrin 4 | KEGG COMPOUND |
| 3-[(2S,3S,7S,17R)-1-acetyl-2,7,12,18-tetrakis(carboxymethyl)-2,7,17-trimethyl-18,19-didehydrocorrin-3,8,13,17-tetrayl]tetrapropanoic acid | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C06407 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| Beilstein:7070412 | Beilstein |