EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H14N2O4 |
| Net Charge | 0 |
| Average Mass | 226.232 |
| Monoisotopic Mass | 226.09536 |
| SMILES | NCc1ncc(CCC(=O)O)c1CC(=O)O |
| InChI | InChI=1S/C10H14N2O4/c11-4-8-7(3-10(15)16)6(5-12-8)1-2-9(13)14/h5,12H,1-4,11H2,(H,13,14)(H,15,16) |
| InChIKey | QSHWIQZFGQKFMA-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Escherichia coli (ncbitaxon:562) | - | PubMed (21988831) | |
| Mus musculus (ncbitaxon:10090) | - | PubMed (19425150) | Source: BioModels - MODEL1507180067 |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| porphobilinogen (CHEBI:17381) has role Escherichia coli metabolite (CHEBI:76971) |
| porphobilinogen (CHEBI:17381) has role metabolite (CHEBI:25212) |
| porphobilinogen (CHEBI:17381) has role mouse metabolite (CHEBI:75771) |
| porphobilinogen (CHEBI:17381) is a aralkylamino compound (CHEBI:64365) |
| porphobilinogen (CHEBI:17381) is a dicarboxylic acid (CHEBI:35692) |
| porphobilinogen (CHEBI:17381) is a pyrroles (CHEBI:26455) |
| porphobilinogen (CHEBI:17381) is conjugate acid of porphobilinogen(1−) (CHEBI:58126) |
| Incoming Relation(s) |
| porphobilinogen(1−) (CHEBI:58126) is conjugate base of porphobilinogen (CHEBI:17381) |
| IUPAC Name |
|---|
| 3-[5-(aminomethyl)-4-(carboxymethyl)-1H-pyrrol-3-yl]propanoic acid |
| Synonym | Source |
|---|---|
| Porphobilinogen | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C00931 | KEGG COMPOUND |
| PBG | PDBeChem |
| DB02272 | DrugBank |
| HMDB0000245 | HMDB |
| PORPHOBILINOGEN | MetaCyc |
| Porphobilinogen | Wikipedia |
| C00007339 | KNApSAcK |
| Registry Numbers | Sources |
|---|---|
| Reaxys:220051 | Reaxys |
| CAS:487-90-1 | KEGG COMPOUND |
| CAS:487-90-1 | ChemIDplus |
| Citations |
|---|