EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H23N2O7PS |
| Net Charge | 0 |
| Average Mass | 358.353 |
| Monoisotopic Mass | 358.09636 |
| SMILES | CC(C)(COP(=O)(O)O)C(O)C(=O)NCCC(=O)NCCS |
| InChI | InChI=1S/C11H23N2O7PS/c1-11(2,7-20-21(17,18)19)9(15)10(16)13-4-3-8(14)12-5-6-22/h9,15,22H,3-7H2,1-2H3,(H,12,14)(H,13,16)(H2,17,18,19) |
| InChIKey | JDMUPRLRUUMCTL-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | cofactor An organic molecule or ion (usually a metal ion) that is required by an enzyme for its activity. It may be attached either loosely (coenzyme) or tightly (prosthetic group). water-soluble vitamin (role) Any vitamin that dissolves in water and readily absorbed into tissues for immediate use. Unlike the fat-soluble vitamins, they are not stored in the body and need to be replenished regularly in the diet and will rarely accumulate to toxic levels since they are quickly excreted from the body via urine. cofactor An organic molecule or ion (usually a metal ion) that is required by an enzyme for its activity. It may be attached either loosely (coenzyme) or tightly (prosthetic group). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pantetheine 4'-phosphate (CHEBI:16858) has role cofactor (CHEBI:23357) |
| pantetheine 4'-phosphate (CHEBI:16858) is a phosphopantetheine (CHEBI:26073) |
| pantetheine 4'-phosphate (CHEBI:16858) is a thiol (CHEBI:29256) |
| pantetheine 4'-phosphate (CHEBI:16858) is conjugate acid of pantetheine 4'-phosphate(2−) (CHEBI:47942) |
| Incoming Relation(s) |
| D-pantetheine 4'-phosphate (CHEBI:4222) is a pantetheine 4'-phosphate (CHEBI:16858) |
| pantetheine 4'-phosphate(2−) (CHEBI:47942) is conjugate base of pantetheine 4'-phosphate (CHEBI:16858) |
| IUPAC Name |
|---|
| N3-[2-hydroxy-3,3-dimethyl-4-(phosphonooxy)butanoyl]-N-(2-sulfanylethyl)-β-alaninamide |
| Synonyms | Source |
|---|---|
| 4'-Phosphopantetheine | KEGG COMPOUND |
| Pantetheine 4'-phosphate | KEGG COMPOUND |
| pantotheine-4'-phosphate | UM-BBD |
| Phosphopantetheine | KEGG COMPOUND |
| Psh-4'-P | ChemIDplus |