EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H15N5O3S |
| Net Charge | 0 |
| Average Mass | 297.340 |
| Monoisotopic Mass | 297.08956 |
| SMILES | CSC[C@H]1O[C@@H](n2cnc3c(N)ncnc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C11H15N5O3S/c1-20-2-5-7(17)8(18)11(19-5)16-4-15-6-9(12)13-3-14-10(6)16/h3-5,7-8,11,17-18H,2H2,1H3,(H2,12,13,14)/t5-,7-,8-,11-/m1/s1 |
| InChIKey | WUUGFSXJNOTRMR-IOSLPCCCSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | DOI (10.1038/nbt.2488) | |
| Chlamydomonas reinhardtii (ncbitaxon:3055) | - | PubMed (25515814) | |
| Saccharomyces cerevisiae (ncbitaxon:4932) | - | PubMed (24678285) | Source: yeast.sf.net |
| Escherichia coli (ncbitaxon:562) | - | PubMed (21988831) | |
| Mus musculus (ncbitaxon:10090) | - | PubMed (19425150) | Source: BioModels - MODEL1507180067 |
| Roles Classification |
|---|
| Biological Roles: | Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). algal metabolite Any eukaryotic metabolite produced during a metabolic reaction in algae including unicellular organisms like chlorella and diatoms to multicellular organisms like giant kelps and brown algae. Saccharomyces cerevisiae metabolite Any fungal metabolite produced during a metabolic reaction in Baker's yeast (Saccharomyces cerevisiae ). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5'-S-methyl-5'-thioadenosine (CHEBI:17509) has functional parent adenosine (CHEBI:16335) |
| 5'-S-methyl-5'-thioadenosine (CHEBI:17509) has role Escherichia coli metabolite (CHEBI:76971) |
| 5'-S-methyl-5'-thioadenosine (CHEBI:17509) has role Saccharomyces cerevisiae metabolite (CHEBI:75772) |
| 5'-S-methyl-5'-thioadenosine (CHEBI:17509) has role algal metabolite (CHEBI:84735) |
| 5'-S-methyl-5'-thioadenosine (CHEBI:17509) has role human metabolite (CHEBI:77746) |
| 5'-S-methyl-5'-thioadenosine (CHEBI:17509) has role mouse metabolite (CHEBI:75771) |
| 5'-S-methyl-5'-thioadenosine (CHEBI:17509) is a thioadenosine (CHEBI:26953) |
| IUPAC Name |
|---|
| 5'-deoxy-5'-(methylsulfanyl)adenosine |
| Synonyms | Source |
|---|---|
| 5'-Methylthioadenosine | KEGG COMPOUND |
| Methylthioadenosine | KEGG COMPOUND |
| 5-Methylthioadenosine | KEGG COMPOUND |
| 5'-Deoxy-5'-(methylthio)adenosine | KEGG COMPOUND |
| Thiomethyladenosine | KEGG COMPOUND |
| MTA | KEGG COMPOUND |
| UniProt Name | Source |
|---|---|
| S-methyl-5'-thioadenosine | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C00170 | KEGG COMPOUND |
| DB02282 | DrugBank |
| 5-METHYLTHIOADENOSINE | MetaCyc |
| HMDB0001173 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Beilstein:42420 | Beilstein |
| Reaxys:42420 | Reaxys |
| CAS:2457-80-9 | KEGG COMPOUND |
| CAS:2457-80-9 | ChemIDplus |
| Citations |
|---|