EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H22O11 |
| Net Charge | 0 |
| Average Mass | 342.297 |
| Monoisotopic Mass | 342.11621 |
| SMILES | OC[C@H]1OC(O)(CO[C@]2(CO)O[C@H](CO)[C@@H](O)[C@@H]2O)[C@@H](O)[C@@H]1O |
| WURCS | WURCS=2.0/2,2,1/[ha122h-2x_2-5][ha122h-2b_2-5]/1-2/a1-b2 |
| InChI | InChI=1S/C12H22O11/c13-1-5-7(16)9(18)11(20,22-5)4-21-12(3-15)10(19)8(17)6(2-14)23-12/h5-10,13-20H,1-4H2/t5-,6-,7-,8-,9+,10+,11?,12-/m1/s1 |
| InChIKey | WOHYVFWWTVNXTP-QPEGTHMASA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Chlamydomonas reinhardtii (ncbitaxon:3055) | - | PubMed (25515814) |
| Roles Classification |
|---|
| Biological Role: | algal metabolite Any eukaryotic metabolite produced during a metabolic reaction in algae including unicellular organisms like chlorella and diatoms to multicellular organisms like giant kelps and brown algae. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| inulobiose (CHEBI:16751) has role algal metabolite (CHEBI:84735) |
| inulobiose (CHEBI:16751) is a glycosyl glycoside (CHEBI:24407) |
| Incoming Relation(s) |
| β-D-fructofuranosyl-(2,1)-β-D-fructofuranose (CHEBI:146129) is a inulobiose (CHEBI:16751) |
| IUPAC Names |
|---|
| 1-O-β-D-fructofuranosyl-D-fructose |
| β-D-fructofuranosyl-(2→1)-D-fructose |
| Synonyms | Source |
|---|---|
| 1-O-beta-D-Fructo-furanosyl-D-fructose | ChemIDplus |
| 1-O-beta-D-Fructo-furanosyl-D-fructose | KEGG COMPOUND |
| Inulobiose | KEGG COMPOUND |
| D-fructosyl-2,1-α-D-fructose | IUBMB |
| UniProt Name | Source |
|---|---|
| inulobiose | UniProt |