EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H10N2O |
| Net Charge | 0 |
| Average Mass | 174.203 |
| Monoisotopic Mass | 174.07931 |
| SMILES | NC(=O)Cc1cnc2ccccc12 |
| InChI | InChI=1S/C10H10N2O/c11-10(13)5-7-6-12-9-4-2-1-3-8(7)9/h1-4,6,12H,5H2,(H2,11,13) |
| InChIKey | ZOAMBXDOGPRZLP-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| indole-3-acetamide (CHEBI:16031) has functional parent acetamide (CHEBI:27856) |
| indole-3-acetamide (CHEBI:16031) has role bacterial metabolite (CHEBI:76969) |
| indole-3-acetamide (CHEBI:16031) has role fungal metabolite (CHEBI:76946) |
| indole-3-acetamide (CHEBI:16031) has role plant metabolite (CHEBI:76924) |
| indole-3-acetamide (CHEBI:16031) is a N-acylammonia (CHEBI:83628) |
| indole-3-acetamide (CHEBI:16031) is a indoles (CHEBI:24828) |
| indole-3-acetamide (CHEBI:16031) is a monocarboxylic acid amide (CHEBI:29347) |
| IUPAC Name |
|---|
| 2-(1H-indol-3-yl)acetamide |
| Synonyms | Source |
|---|---|
| 1H-indole-3-acetamide | NIST Chemistry WebBook |
| 3-indoleacetamide | NIST Chemistry WebBook |
| Indole-3-acetamide | KEGG COMPOUND |
| Indole-3-acetamide | KEGG COMPOUND |
| indoleacetamide | ChemIDplus |
| UniProt Name | Source |
|---|---|
| indole-3-acetamide | UniProt |
| Citations |
|---|