EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H37N3O13 |
| Net Charge | 0 |
| Average Mass | 527.524 |
| Monoisotopic Mass | 527.23264 |
| SMILES | CN[C@H]1C[C@@H](N)[C@H](O)[C@@H](O[C@@H]2O[C@H](CO)[C@H](O)[C@@H]3O[C@]4(O[C@H]23)O[C@H](C(N)CO)[C@H](O)[C@H](O)[C@H]4O)[C@@H]1O |
| InChI | InChI=1S/C20H37N3O13/c1-23-7-2-5(21)9(26)15(10(7)27)33-19-17-16(11(28)8(4-25)32-19)35-20(36-17)18(31)13(30)12(29)14(34-20)6(22)3-24/h5-19,23-31H,2-4,21-22H2,1H3/t5-,6?,7+,8-,9+,10-,11+,12-,13+,14-,15-,16+,17+,18-,19+,20-/m1/s1 |
| InChIKey | GRRNUXAQVGOGFE-NZSRVPFOSA-N |
| Roles Classification |
|---|
| Biological Role: | antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Application: | anthelminthic drug Substance intended to kill parasitic worms (helminths). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| hygromycin B (CHEBI:16976) has role anthelminthic drug (CHEBI:35443) |
| hygromycin B (CHEBI:16976) is a hygromycin (CHEBI:24753) |
| hygromycin B (CHEBI:16976) is a ortho ester (CHEBI:71989) |
| hygromycin B (CHEBI:16976) is conjugate base of hygromycin B(3+) (CHEBI:57971) |
| Incoming Relation(s) |
| 4-O-phosphohygromycin B (CHEBI:52138) has functional parent hygromycin B (CHEBI:16976) |
| hygromycin B(3+) (CHEBI:57971) is conjugate acid of hygromycin B (CHEBI:16976) |
| IUPAC Name |
|---|
| (1R,2S,3R,5S,6R)-3-amino-2,6-dihydroxy-5-(methylamino)cyclohexyl O-6-amino-6-deoxy-L-glycero-D-galacto-heptopyranosylidene-(1→2-3)-β-D-talopyranoside |
| Synonyms | Source |
|---|---|
| Antibiotic A-396-II | KEGG COMPOUND |
| O-6-amino-6-deoxy-L-glycero-D-galacto-heptopyranosylidene-(1→2-3)-O-β-D-talopyranosyl-(1→5)-2-deoxy-N3-methyl-D-streptamine | ChEBI |
| Hygromycin B | KEGG COMPOUND |
| HYGROMYCIN B | PDBeChem |
| Registry Numbers | Sources |
|---|---|
| Beilstein:6755837 | Beilstein |
| CAS:31282-04-9 | KEGG COMPOUND |
| CAS:31282-04-9 | ChemIDplus |