EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H19N3O6S |
| Net Charge | 0 |
| Average Mass | 357.388 |
| Monoisotopic Mass | 357.09946 |
| SMILES | [H][C@]12SCC(C)=C(C(=O)O)N1C(=O)[C@H]2NC(=O)CCC[C@@H](N)C(=O)O |
| InChI | InChI=1S/C14H19N3O6S/c1-6-5-24-12-9(11(19)17(12)10(6)14(22)23)16-8(18)4-2-3-7(15)13(20)21/h7,9,12H,2-5,15H2,1H3,(H,16,18)(H,20,21)(H,22,23)/t7-,9-,12-/m1/s1 |
| InChIKey | NNQIJOYQWYKBOW-JWKOBGCHSA-N |
| Roles Classification |
|---|
| Biological Roles: | drug allergen Any drug which causes the onset of an allergic reaction. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Application: | drug allergen Any drug which causes the onset of an allergic reaction. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| deacetoxycephalosporin C (CHEBI:18229) has functional parent cephalosporin C (CHEBI:15776) |
| deacetoxycephalosporin C (CHEBI:18229) is a cephalosporin (CHEBI:23066) |
| deacetoxycephalosporin C (CHEBI:18229) is conjugate acid of deacetoxycephalosporin C(1−) (CHEBI:58415) |
| Incoming Relation(s) |
| deacetoxycephalosporin C(1−) (CHEBI:58415) is conjugate base of deacetoxycephalosporin C (CHEBI:18229) |
| IUPAC Name |
|---|
| (6R,7R)-7-{[(5R)-5-amino-5-carboxypentanoyl]amino}-3-methyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
| Synonyms | Source |
|---|---|
| Deacetoxycephalosporin C | KEGG COMPOUND |
| DAOC | KEGG COMPOUND |
| De(acetyloxy)cephalosporin C | ChemIDplus |
| Desacetoxycephalosphorin C | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| CAS:26924-74-3 | ChemIDplus |
| CAS:26924-74-3 | KEGG COMPOUND |