EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H16N2O11P2 |
| Net Charge | 0 |
| Average Mass | 402.189 |
| Monoisotopic Mass | 402.02293 |
| SMILES | Cc1cn([C@H]2C[C@H](O)[C@@H](COP(=O)(O)OP(=O)(O)O)O2)c(=O)nc1=O |
| InChI | InChI=1S/C10H16N2O11P2/c1-5-3-12(10(15)11-9(5)14)8-2-6(13)7(22-8)4-21-25(19,20)23-24(16,17)18/h3,6-8,13H,2,4H2,1H3,(H,19,20)(H,11,14,15)(H2,16,17,18)/t6-,7+,8+/m0/s1 |
| InChIKey | UJLXYODCHAELLY-XLPZGREQSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Escherichia coli (ncbitaxon:562) | - | PubMed (21988831) | |
| Homo sapiens (ncbitaxon:9606) | - | PubMed (20065942) | |
| Mus musculus (ncbitaxon:10090) | - | PubMed (19425150) | Source: BioModels - MODEL1507180067 |
| Roles Classification |
|---|
| Biological Roles: | Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dTDP (CHEBI:18075) has role Escherichia coli metabolite (CHEBI:76971) |
| dTDP (CHEBI:18075) has role mouse metabolite (CHEBI:75771) |
| dTDP (CHEBI:18075) is a pyrimidine 2'-deoxyribonucleoside 5'-diphosphate (CHEBI:37037) |
| dTDP (CHEBI:18075) is a thymidine phosphate (CHEBI:27001) |
| dTDP (CHEBI:18075) is conjugate acid of dTDP(3−) (CHEBI:58369) |
| Incoming Relation(s) |
| dTDP-sugar (CHEBI:23557) has functional parent dTDP (CHEBI:18075) |
| ethyl-dTDP (CHEBI:62904) has functional parent dTDP (CHEBI:18075) |
| dTDP(3−) (CHEBI:58369) is conjugate base of dTDP (CHEBI:18075) |
| IUPAC Name |
|---|
| thymidine 5'-(trihydrogen diphosphate) |
| Synonyms | Source |
|---|---|
| 2'-deoxyribosylthymine 5'-(trihydrogen diphosphate) | ChEBI |
| deoxy-TDP | ChemIDplus |
| Deoxythymidine 5'-diphosphate | KEGG COMPOUND |
| dTDP | KEGG COMPOUND |
| thymidine 5'-diphosphate | ChemIDplus |
| THYMIDINE-5'- DIPHOSPHATE | PDBeChem |
| Manual Xrefs | Databases |
|---|---|
| C00019696 | KNApSAcK |
| C00363 | KEGG COMPOUND |
| DB03103 | DrugBank |
| HMDB0001274 | HMDB |
| TDP | MetaCyc |
| Thymidine_diphosphate | Wikipedia |
| TYD | PDBeChem |
| Registry Numbers | Sources |
|---|---|
| Beilstein:64132 | Beilstein |
| CAS:491-97-4 | ChemIDplus |
| CAS:491-97-4 | KEGG COMPOUND |
| Citations |
|---|