EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H9I2NO3 |
| Net Charge | 0 |
| Average Mass | 432.983 |
| Monoisotopic Mass | 432.86719 |
| SMILES | N[C@@H](Cc1cc(I)c(O)c(I)c1)C(=O)O |
| InChI | InChI=1S/C9H9I2NO3/c10-5-1-4(2-6(11)8(5)13)3-7(12)9(14)15/h1-2,7,13H,3,12H2,(H,14,15)/t7-/m0/s1 |
| InChIKey | NYPYHUZRZVSYKL-ZETCQYMHSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | DOI (10.1038/nbt.2488) | |
| Mus musculus (ncbitaxon:10090) | - | PubMed (19425150) | Source: BioModels - MODEL1507180067 |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3,5-diiodo-L-tyrosine (CHEBI:15768) has role human metabolite (CHEBI:77746) |
| 3,5-diiodo-L-tyrosine (CHEBI:15768) has role mouse metabolite (CHEBI:75771) |
| 3,5-diiodo-L-tyrosine (CHEBI:15768) is a L-tyrosine derivative (CHEBI:27177) |
| 3,5-diiodo-L-tyrosine (CHEBI:15768) is a diiodotyrosine (CHEBI:23796) |
| 3,5-diiodo-L-tyrosine (CHEBI:15768) is a non-proteinogenic L-α-amino acid (CHEBI:83822) |
| 3,5-diiodo-L-tyrosine (CHEBI:15768) is conjugate acid of 3,5-diiodo-L-tyrosinate(1−) (CHEBI:57506) |
| Incoming Relation(s) |
| N-acetyl-L-phenylalanyl-L-diiodotyrosine (CHEBI:28253) has functional parent 3,5-diiodo-L-tyrosine (CHEBI:15768) |
| 3,5-diiodo-L-tyrosinate(1−) (CHEBI:57506) is conjugate base of 3,5-diiodo-L-tyrosine (CHEBI:15768) |
| 3,5-diiodo-L-tyrosine residue (CHEBI:90871) is substituent group from 3,5-diiodo-L-tyrosine (CHEBI:15768) |
| IUPAC Name |
|---|
| 3,5-diiodo-L-tyrosine |
| Synonyms | Source |
|---|---|
| (2S)-2-amino-3-(4-hydroxy-3,5-diiodophenyl)propanoic acid | IUPAC |
| 3,5-Diiodo-L-tyrosine | KEGG COMPOUND |
| 3,5-Diiodotyrosine | KEGG COMPOUND |
| 3,5-DIIODOTYROSINE | PDBeChem |
| diiodotyrosine | ChEBI |
| DiIY | ChEBI |
| Citations |
|---|