EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | (C6H11NO4)n.H2O |
| Net Charge | 0 |
| Average Mass | 179.172 |
| Monoisotopic Mass | 179.07937 |
| SMILES | [H]O[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1N |
| InChI | InChI=1S/C6H13NO5/c7-3-5(10)4(9)2(1-8)12-6(3)11/h2-6,8-11H,1,7H2/t2-,3-,4-,5-,6-/m1/s1 |
| InChIKey | MSWZFWKMSRAUBD-QZABAPFNSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Saccharomyces cerevisiae (ncbitaxon:4932) | - | PubMed (24678285) | Source: yeast.sf.net |
| Roles Classification |
|---|
| Biological Roles: | Saccharomyces cerevisiae metabolite Any fungal metabolite produced during a metabolic reaction in Baker's yeast (Saccharomyces cerevisiae ). elicitor A chemical or biochemical compound that is introduced in small concentrations to a living system to promote the biosynthesis of the target bioactive compound. |
| Applications: | vulnerary A drug used in treating and healing of wounds. plant activator Any compound that protects plants by activating their defence mechanisms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| chitosan (CHEBI:16261) has role Saccharomyces cerevisiae metabolite (CHEBI:75772) |
| chitosan (CHEBI:16261) has role elicitor (CHEBI:192504) |
| chitosan (CHEBI:16261) has role plant activator (CHEBI:73182) |
| chitosan (CHEBI:16261) has role vulnerary (CHEBI:73336) |
| chitosan (CHEBI:16261) is a aminoglycan (CHEBI:22506) |
| chitosan (CHEBI:16261) is a exopolysaccharide (CHEBI:72813) |
| chitosan (CHEBI:16261) is conjugate base of cationic chitosan (CHEBI:57704) |
| Incoming Relation(s) |
| cationic chitosan (CHEBI:57704) is conjugate acid of chitosan (CHEBI:16261) |
| IUPAC Name |
|---|
| (1→4)-2-amino-2-deoxy-β-D-glucan |
| INN | Source |
|---|---|
| poliglusam | ChemIDplus |
| Synonyms | Source |
|---|---|
| Chitosan | KEGG COMPOUND |
| beta-1,4-Poly-D-glucosamine | KEGG COMPOUND |
| [4)-β-D-GlcpN(1→]n | IUPAC |
| Deacetylchitin | ChemIDplus |
| Citations |
|---|