EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C39H60N7O18P3S |
| Net Charge | -4 |
| Average Mass | 1039.929 |
| Monoisotopic Mass | 1039.29503 |
| SMILES | [H][C@](O)(C(=O)NCCC(=O)NCCSC(=O)CCCCCCC[C@H]1CCC(=O)[C@H]1C/C=C\CC)C(C)(C)COP(=O)([O-])OP(=O)([O-])OC[C@H]1O[C@@H](n2cnc3c(N)ncnc32)C(O)[C@H]1OP(=O)([O-])[O-] |
| InChI | InChI=1S/C39H64N7O18P3S/c1-4-5-9-13-26-25(15-16-27(26)47)12-10-7-6-8-11-14-30(49)68-20-19-41-29(48)17-18-42-37(52)34(51)39(2,3)22-61-67(58,59)64-66(56,57)60-21-28-33(63-65(53,54)55)32(50)38(62-28)46-24-45-31-35(40)43-23-44-36(31)46/h5,9,23-26,28,32-34,38,50-51H,4,6-8,10-22H2,1-3H3,(H,41,48)(H,42,52)(H,56,57)(H,58,59)(H2,40,43,44)(H2,53,54,55)/p-4/b9-5-/t25-,26-,28+,32?,33-,34-,38+/m0/s1 |
| InChIKey | JZIQDJLBFKTBAK-JWGFFLAFSA-J |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| OPC8-CoA (4-) (CHEBI:138396) is a acyl-CoA(4−) (CHEBI:58342) |
| OPC8-CoA (4-) (CHEBI:138396) is a Jasmonate derivatives (CHEBI:167055) |
| OPC8-CoA (4-) (CHEBI:138396) is conjugate base of OPC8-CoA (CHEBI:80448) |
| Incoming Relation(s) |
| OPC8-CoA (CHEBI:80448) is conjugate acid of OPC8-CoA (4-) (CHEBI:138396) |
| UniProt Name | Source |
|---|---|
| OPC8-CoA | UniProt |
| Manual Xrefs | Databases |
|---|---|
| CPD-11517 | MetaCyc |
| Citations |
|---|