EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C72H100CoN18O17P |
| Net Charge | 0 |
| Average Mass | 1579.608 |
| Monoisotopic Mass | 1578.65834 |
| SMILES | [H][C@]12[C@H](CC(N)=O)[C@@]3(C)CCC(=O)NC[C@@H](C)OP(=O)([O-])O[C@H]4[C@@H](O)[C@H](O[C@@H]4CO)n4c[n+](c5cc(C)c(C)cc54)[Co-3]456([CH2][C@H]7O[C@@H](n8cnc9c(N)ncnc98)[C@H](O)[C@@H]7O)[N]1C3=C(C)C1=[N+]4C(=CC3=[N+]5C(=C(C)C4=[N+]6[C@]2(C)[C@@](C)(CC(N)=O)[C@@H]4CCC(N)=O)[C@@](C)(CC(N)=O)[C@@H]3CCC(N)=O)C(C)(C)[C@@H]1CCC(N)=O |
| InChI | InChI=1S/C62H90N13O14P.C10H12N5O3.Co/c1-29-20-39-40(21-30(29)2)75(28-70-39)57-52(84)53(41(27-76)87-57)89-90(85,86)88-31(3)26-69-49(83)18-19-59(8)37(22-46(66)80)56-62(11)61(10,25-48(68)82)36(14-17-45(65)79)51(74-62)33(5)55-60(9,24-47(67)81)34(12-15-43(63)77)38(71-55)23-42-58(6,7)35(13-16-44(64)78)50(72-42)32(4)54(59)73-56;1-4-6(16)7(17)10(18-4)15-3-14-5-8(11)12-2-13-9(5)15;/h20-21,23,28,31,34-37,41,52-53,56-57,76,84H,12-19,22,24-27H2,1-11H3,(H15,63,64,65,66,67,68,69,71,72,73,74,77,78,79,80,81,82,83,85,86);2-4,6-7,10,16-17H,1H2,(H2,11,12,13);/q;;+2/p-2/t31-,34-,35-,36-,37+,41-,52-,53-,56-,57+,59-,60+,61+,62+;4-,6-,7-,10-;/m11./s1 |
| InChIKey | ZIHHMGTYZOSFRC-OUCXYWSSSA-L |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Escherichia coli (ncbitaxon:562) | - | PubMed (21988831) | |
| Homo sapiens (ncbitaxon:9606) | - | DOI (10.1038/nbt.2488) |
| Roles Classification |
|---|
| Biological Roles: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). prosthetic group A tightly bound, specific nonpolypeptide unit in a protein determining and involved in its biological activity. cofactor An organic molecule or ion (usually a metal ion) that is required by an enzyme for its activity. It may be attached either loosely (coenzyme) or tightly (prosthetic group). coenzyme A low-molecular-weight, non-protein organic compound participating in enzymatic reactions as dissociable acceptor or donor of chemical groups or electrons. Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. cofactor An organic molecule or ion (usually a metal ion) that is required by an enzyme for its activity. It may be attached either loosely (coenzyme) or tightly (prosthetic group). water-soluble vitamin (role) Any vitamin that dissolves in water and readily absorbed into tissues for immediate use. Unlike the fat-soluble vitamins, they are not stored in the body and need to be replenished regularly in the diet and will rarely accumulate to toxic levels since they are quickly excreted from the body via urine. |
| Applications: | dermatologic drug A drug used to treat or prevent skin disorders or for the routine care of skin. anti-anaemic agent A compound which increases either the number of red cells or the amount of haemoglobin in the blood. nutraceutical A product in capsule, tablet or liquid form that provide essential nutrients, such as a vitamin, an essential mineral, a protein, an herb, or similar nutritional substance. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cobamamide (CHEBI:18408) has role Escherichia coli metabolite (CHEBI:76971) |
| cobamamide (CHEBI:18408) has role anti-anaemic agent (CHEBI:75835) |
| cobamamide (CHEBI:18408) has role coenzyme (CHEBI:23354) |
| cobamamide (CHEBI:18408) has role cofactor (CHEBI:23357) |
| cobamamide (CHEBI:18408) has role dermatologic drug (CHEBI:50177) |
| cobamamide (CHEBI:18408) has role human metabolite (CHEBI:77746) |
| cobamamide (CHEBI:18408) has role prosthetic group (CHEBI:26348) |
| cobamamide (CHEBI:18408) is a cobalamins (CHEBI:23334) |
| cobamamide (CHEBI:18408) is a corrinoid (CHEBI:33913) |
| Incoming Relation(s) |
| adenosylcobalamin 5'-phosphate (CHEBI:49100) has functional parent cobamamide (CHEBI:18408) |
| IUPAC Name |
|---|
| Coα-[α-(5,6-dimethylbenzimidazolyl)]-Coβ-(5'-deoxy-5'-adenosyl)cobamide |
| INNs | Source |
|---|---|
| cobamamida | ChemIDplus |
| cobamamide | ChemIDplus |
| cobamamide | WHO MedNet |
| cobamamidum | ChemIDplus |
| Synonyms | Source |
|---|---|
| 5,6-Dimethylbenzimidazolyl-5-deoxyadenosyl-cobamide | KEGG COMPOUND |
| 5,6-Dimethylbenzimidazolyl-Co-5'-deoxy-5'-adenosylcobamide | KEGG COMPOUND |
| (5,6-dimethylbenzimidazolyl)cobamide coenzyme | MetaCyc |
| (5,6-Dimethylbenzimidazolyl)cobamide coenzyme | KEGG COMPOUND |
| 5'-Deoxy-5'-adenosyl-5,6-dimethylbenzimidazolylcobamide | KEGG COMPOUND |
| 5'-Deoxy-5'-adenosylcobalamin | KEGG COMPOUND |
| Brand Name | Source |
|---|---|
| Calomide | KEGG DRUG |
| UniProt Name | Source |
|---|---|
| adenosylcob(III)alamin | UniProt |
| Manual Xrefs | Databases |
|---|---|
| ADENOSYLCOBALAMIN | MetaCyc |
| B1Z | PDBeChem |
| C00194 | KEGG COMPOUND |
| Cobamamide | Wikipedia |
| DB11191 | DrugBank |
| HMDB0002086 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4122932 | Reaxys |
| Gmelin:439994 | Gmelin |
| CAS:13870-90-1 | KEGG COMPOUND |
| CAS:13870-90-1 | ChemIDplus |
| Citations |
|---|