EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H14N2O12P2 |
| Net Charge | 0 |
| Average Mass | 404.161 |
| Monoisotopic Mass | 404.00220 |
| SMILES | O=c1ccn([C@@H]2O[C@H](COP(=O)(O)OP(=O)(O)O)[C@@H](O)[C@H]2O)c(=O)n1 |
| InChI | InChI=1S/C9H14N2O12P2/c12-5-1-2-11(9(15)10-5)8-7(14)6(13)4(22-8)3-21-25(19,20)23-24(16,17)18/h1-2,4,6-8,13-14H,3H2,(H,19,20)(H,10,12,15)(H2,16,17,18)/t4-,6-,7-,8-/m1/s1 |
| InChIKey | XCCTYIAWTASOJW-XVFCMESISA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Escherichia coli (ncbitaxon:562) | - | PubMed (21988831) | |
| Mus musculus (ncbitaxon:10090) | - | PubMed (19425150) | Source: BioModels - MODEL1507180067 |
| Roles Classification |
|---|
| Biological Roles: | mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| UDP (CHEBI:17659) has role Escherichia coli metabolite (CHEBI:76971) |
| UDP (CHEBI:17659) has role mouse metabolite (CHEBI:75771) |
| UDP (CHEBI:17659) is a pyrimidine ribonucleoside 5'-diphosphate (CHEBI:37039) |
| UDP (CHEBI:17659) is a uridine 5'-phosphate (CHEBI:27232) |
| UDP (CHEBI:17659) is conjugate acid of UDP(3−) (CHEBI:58223) |
| Incoming Relation(s) |
| UDP-sugar (CHEBI:17297) has functional parent UDP (CHEBI:17659) |
| UDP(3−) (CHEBI:58223) is conjugate base of UDP (CHEBI:17659) |
| IUPAC Name |
|---|
| uridine 5'-(trihydrogen diphosphate) |
| Synonyms | Source |
|---|---|
| UDP | KEGG COMPOUND |
| Uridine 5'-diphosphate | KEGG COMPOUND |
| Uridine diphosphate | ChemIDplus |