EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H30O14 |
| Net Charge | 0 |
| Average Mass | 578.523 |
| Monoisotopic Mass | 578.16356 |
| SMILES | C[C@@H]1O[C@@H](Oc2cc(O)c3c(=O)c(O[C@@H]4O[C@@H](C)[C@H](O)[C@@H](O)[C@H]4O)c(-c4ccc(O)cc4)oc3c2)[C@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C27H30O14/c1-9-17(30)20(33)22(35)26(37-9)39-13-7-14(29)16-15(8-13)40-24(11-3-5-12(28)6-4-11)25(19(16)32)41-27-23(36)21(34)18(31)10(2)38-27/h3-10,17-18,20-23,26-31,33-36H,1-2H3/t9-,10-,17-,18-,20+,21+,22+,23+,26-,27-/m0/s1 |
| InChIKey | PUPKKEQDLNREIM-QNSQPKOQSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Arabidopsis thaliana (ncbitaxon:3702) | |||
| - | PubMed (27432888) | ||
| - | MetaboLights (MTBLS129) | ||
| Bauhinia forficata (ncbitaxon:413686) | leaf (BTO:0000713) | PubMed (15501431) | |
| Corynandra viscosa (ncbitaxon:190804) | leaf (BTO:0000713) | PubMed (28135851) | |
| Dryopteris crassirhizoma (ncbitaxon:97234) | - | PubMed (24013342) | |
| Hedyotis verticillata (ncbitaxon:462690) | leaf (BTO:0000713) | PubMed (7938277) | |
| Hibiscus cannabinus (ncbitaxon:229543) | leaf (BTO:0000713) | PubMed (21512441) | |
| Justicia spicigera (ncbitaxon:141992) | - | PubMed (23211658) | |
| Lotus edulis (ncbitaxon:181270) | |||
| branch (BTO:0000148) | PubMed (22014228) | Methanolic extract of leaves and branches | |
| leaf (BTO:0000713) | PubMed (22014228) | Methanolic extract of leaves and branches | |
| Sedum dendroideum (ncbitaxon:1239900) | leaf (BTO:0000713) | PubMed (24817132) | |
| Siraitia grosvenorii (ncbitaxon:190515) | fruit (BTO:0000486) | PubMed (16268506) | |
| Vicia faba (ncbitaxon:3906) | |||
| leaf (BTO:0000713) | PubMed (22014228) | Methanolic extract of leaves and branches | |
| branch (BTO:0000148) | PubMed (22014228) | Methanolic extract of leaves and branches |
| Roles Classification |
|---|
| Biological Roles: | immunomodulator Biologically active substance whose activity affects or plays a role in the functioning of the immune system. apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Applications: | anti-inflammatory agent Any compound that has anti-inflammatory effects. immunomodulator Biologically active substance whose activity affects or plays a role in the functioning of the immune system. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. hypoglycemic agent A drug which lowers the blood glucose level. bone density conservation agent An agent that inhibits bone resorption and/or favor bone mineralization and bone regeneration. Used to heal bone fractures and to treat bone diseases such as osteopenia and osteoporosis. antidepressant Antidepressants are mood-stimulating drugs used primarily in the treatment of affective disorders and related conditions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| kaempferol 3,7-di-O-α-L-rhamnoside (CHEBI:68883) has functional parent kaempferol (CHEBI:28499) |
| kaempferol 3,7-di-O-α-L-rhamnoside (CHEBI:68883) has role anti-inflammatory agent (CHEBI:67079) |
| kaempferol 3,7-di-O-α-L-rhamnoside (CHEBI:68883) has role antidepressant (CHEBI:35469) |
| kaempferol 3,7-di-O-α-L-rhamnoside (CHEBI:68883) has role antineoplastic agent (CHEBI:35610) |
| kaempferol 3,7-di-O-α-L-rhamnoside (CHEBI:68883) has role apoptosis inducer (CHEBI:68495) |
| kaempferol 3,7-di-O-α-L-rhamnoside (CHEBI:68883) has role bone density conservation agent (CHEBI:50646) |
| kaempferol 3,7-di-O-α-L-rhamnoside (CHEBI:68883) has role hypoglycemic agent (CHEBI:35526) |
| kaempferol 3,7-di-O-α-L-rhamnoside (CHEBI:68883) has role immunomodulator (CHEBI:50846) |
| kaempferol 3,7-di-O-α-L-rhamnoside (CHEBI:68883) has role plant metabolite (CHEBI:76924) |
| kaempferol 3,7-di-O-α-L-rhamnoside (CHEBI:68883) is a dihydroxyflavone (CHEBI:38686) |
| kaempferol 3,7-di-O-α-L-rhamnoside (CHEBI:68883) is a glycosyloxyflavone (CHEBI:50018) |
| kaempferol 3,7-di-O-α-L-rhamnoside (CHEBI:68883) is a monosaccharide derivative (CHEBI:63367) |
| kaempferol 3,7-di-O-α-L-rhamnoside (CHEBI:68883) is a polyphenol (CHEBI:26195) |
| kaempferol 3,7-di-O-α-L-rhamnoside (CHEBI:68883) is a α-L-rhamnoside (CHEBI:27848) |
| IUPAC Names |
|---|
| 3-[(6-deoxy-α-L-mannopyranosyl)oxy]-5-hydroxy-2-(4-hydroxyphenyl)-4-oxo-4H-chromen-7-yl 6-deoxy-α-L-mannopyranoside |
| 7-[(6-deoxy-α-L-mannopyranosyl)oxy]-5-hydroxy-2-(4-hydroxyphenyl)-4-oxo-4H-1-benzopyran-3-yl 6-deoxy-α-L-mannopyranoside |
| Synonyms | Source |
|---|---|
| 3,7-bis((6-deoxy-α-L-mannopyranosyl)oxy)-5-hydroxy-2-(4-hydroxyphenyl)-4H-1-benzopyran-4-one | ChemIDplus |
| kaempferitrin | ChemIDplus |
| Kaempferitrin | ChemIDplus |
| kaempferol 3,7-bisrhamnoside | ChemIDplus |
| Kaempferol 3,7-bisrhamnoside | ChemIDplus |
| kaempferol 3,7-dirhamnoside | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| C16981 | KEGG COMPOUND |
| HMDB0037438 | HMDB |
| Kaempferitrin | Wikipedia |
| kaempferol-3-rhamnoside-7-rhamnoside | MetaCyc |
| LMPK12111865 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:73958 | Reaxys |
| CAS:482-38-2 | ChemIDplus |
| CAS:482-38-2 | KEGG COMPOUND |
| Citations |
|---|