EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H35N9O15P2 |
| Net Charge | 0 |
| Average Mass | 787.573 |
| Monoisotopic Mass | 787.17278 |
| SMILES | Cc1cc2c(cc1C)N(C[C@H](O)[C@H](O)[C@H](O)COP(=O)(O)OP(=O)(O)OC[C@H]1O[C@@H](n3cnc4c(N)ncnc43)[C@H](O)[C@@H]1O)c1nc(=O)nc(=O)c1N2 |
| InChI | InChI=1S/C27H35N9O15P2/c1-10-3-12-13(4-11(10)2)35(24-18(32-12)25(42)34-27(43)33-24)5-14(37)19(39)15(38)6-48-52(44,45)51-53(46,47)49-7-16-20(40)21(41)26(50-16)36-9-31-17-22(28)29-8-30-23(17)36/h3-4,8-9,14-16,19-21,26,32,37-41H,5-7H2,1-2H3,(H,44,45)(H,46,47)(H2,28,29,30)(H2,33,34,42,43)/t14-,15+,16+,19-,20+,21+,26+/m0/s1 |
| InChIKey | YPZRHBJKEMOYQH-UYBVJOGSSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Escherichia coli (ncbitaxon:562) | - | PubMed (21988831) | |
| Mus musculus (ncbitaxon:10090) | - | PubMed (19425150) | Source: BioModels - MODEL1507180067 |
| Roles Classification |
|---|
| Biological Roles: | Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). cofactor An organic molecule or ion (usually a metal ion) that is required by an enzyme for its activity. It may be attached either loosely (coenzyme) or tightly (prosthetic group). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| FADH2 (CHEBI:17877) has role Escherichia coli metabolite (CHEBI:76971) |
| FADH2 (CHEBI:17877) has role mouse metabolite (CHEBI:75771) |
| FADH2 (CHEBI:17877) is a flavin adenine dinucleotide (CHEBI:24040) |
| FADH2 (CHEBI:17877) is conjugate acid of FADH2(2−) (CHEBI:58307) |
| Incoming Relation(s) |
| N5-sulfo-FADH2 (CHEBI:45686) has functional parent FADH2 (CHEBI:17877) |
| FADH2(2−) (CHEBI:58307) is conjugate base of FADH2 (CHEBI:17877) |
| IUPAC Name |
|---|
| adenosine 5'-(3-{D-ribo-5-[7,8-dimethyl-2,4-dioxo-1,3,4,5-tetrahydrobenzo[g]pteridin-10(2H)-yl]-2,3,4-trihydroxypentyl} dihydrogen diphosphate) |
| Synonyms | Source |
|---|---|
| 1,5-dihydro-FAD | ChemIDplus |
| DIHYDROFLAVINE-ADENINE DINUCLEOTIDE | PDBeChem |
| FADH2 | KEGG COMPOUND |
| flavin adenine dinucleotide (reduced) | ChEBI |