EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H25N3O15P2 |
| Net Charge | 0 |
| Average Mass | 537.308 |
| Monoisotopic Mass | 537.07609 |
| SMILES | Nc1ccn([C@@H]2O[C@H](COP(=O)(O)OP(=O)(O)OC[C@@H](O)[C@@H](O)[C@@H](O)CO)[C@@H](O)[C@H]2O)c(=O)n1 |
| InChI | InChI=1S/C14H25N3O15P2/c15-9-1-2-17(14(24)16-9)13-12(23)11(22)8(31-13)5-30-34(27,28)32-33(25,26)29-4-7(20)10(21)6(19)3-18/h1-2,6-8,10-13,18-23H,3-5H2,(H,25,26)(H,27,28)(H2,15,16,24)/t6-,7+,8+,10-,11+,12+,13+/m0/s1 |
| InChIKey | DPJKHFICSGCNIR-HRENORGGSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| CDP-ribitol (CHEBI:16022) is a nucleotide-alditol (CHEBI:35240) |
| CDP-ribitol (CHEBI:16022) is conjugate acid of CDP-ribitol(2−) (CHEBI:57608) |
| Incoming Relation(s) |
| CDP-ribitol(2−) (CHEBI:57608) is conjugate base of CDP-ribitol (CHEBI:16022) |
| IUPAC Name |
|---|
| cytidine 5'-{3-[(2R,3S,4S)-2,3,4,5-tetrahydroxypentyl] dihydrogen diphosphate} |
| Synonyms | Source |
|---|---|
| CDP 5-ester with D-ribitol | KEGG COMPOUND |
| CDP-L-ribitol | KEGG COMPOUND |
| Cdp ribitol | ChemIDplus |
| CDPribitol | KEGG COMPOUND |
| Cytidine 5'-(trihydrogen diphosphate), P'-5-ester with D-ribitol | ChemIDplus |
| Cytidine diphosphate ribitol | ChemIDplus |