EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H13N2O6P |
| Net Charge | 0 |
| Average Mass | 228.141 |
| Monoisotopic Mass | 228.05112 |
| SMILES | NCCOP(=O)(O)OC[C@H](N)C(=O)O |
| InChI | InChI=1S/C5H13N2O6P/c6-1-2-12-14(10,11)13-3-4(7)5(8)9/h4H,1-3,6-7H2,(H,8,9)(H,10,11)/t4-/m0/s1 |
| InChIKey | UQDJGEHQDNVPGU-BYPYZUCNSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| L-serine phosphoethanolamine (CHEBI:16542) is a serine phosphoethanolamine (CHEBI:15916) |
| L-serine phosphoethanolamine (CHEBI:16542) is tautomer of L-serine phosphoethanolamine dizwitterion (CHEBI:57804) |
| Incoming Relation(s) |
| L-serine phosphoethanolamine dizwitterion (CHEBI:57804) is tautomer of L-serine phosphoethanolamine (CHEBI:16542) |
| IUPAC Name |
|---|
| L-serine 3-(2-aminoethyl hydrogen phosphate) |
| Synonyms | Source |
|---|---|
| O-[(2-aminoethoxy)(hydroxy)phosphoryl]-L-serine | IUPAC |
| serine phosphoethanolamine | KEGG COMPOUND |
| L-serine, 2-aminoethyl hydrogen phosphate (ester) | ChEBI |
| L-serine ethanolamine phosphate | ChEBI |
| L-serine ethanolamine phosphodiester | ChEBI |
| L-serine-phosphoethanolamine | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C03872 | KEGG COMPOUND |
| FDB008641 | FooDB |
| HMDB0031950 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:1186-34-1 | HMDB |
| Citations |
|---|