EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| ChEBI ID | CHEBI:2719 |
| ChEBI Name | Ile5-angiotensin II |
| Stars | |
| ASCII Name | Ile(5)-angiotensin II |
| Definition | An angiotensin II that acts on the central nervous system (PDB entry: 1N9V). |
| Secondary ChEBI ID | CHEBI:131170 |
| Last Modified | 17 April 2023 |
| Downloads |
| Formula | C50H71N13O12 |
| Net Charge | 0 |
| Average Mass | 1046.197 |
| Monoisotopic Mass | 1045.53451 |
| SMILES | CC[C@H](C)[C@H](NC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)[C@@H](NC(=O)[C@H](CCCNC(=N)N)NC(=O)[C@@H](N)CC(=O)O)C(C)C)C(=O)N[C@@H](Cc1cncn1)C(=O)N1CCC[C@H]1C(=O)N[C@@H](Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C50H71N13O12/c1-5-28(4)41(47(72)59-36(23-31-25-54-26-56-31)48(73)63-20-10-14-38(63)45(70)60-37(49(74)75)22-29-11-7-6-8-12-29)62-44(69)35(21-30-15-17-32(64)18-16-30)58-46(71)40(27(2)3)61-43(68)34(13-9-19-55-50(52)53)57-42(67)33(51)24-39(65)66/h6-8,11-12,15-18,25-28,33-38,40-41,64H,5,9-10,13-14,19-24,51H2,1-4H3,(H,54,56)(H,57,67)(H,58,71)(H,59,72)(H,60,70)(H,61,68)(H,62,69)(H,65,66)(H,74,75)(H4,52,53,55)/t28-,33-,34-,35-,36-,37-,38-,40-,41-/m0/s1 |
| InChIKey | CZGUSIXMZVURDU-JZXHSEFVSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | PubMed (16672146) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). hormone Originally referring to an endogenous compound that is formed in specialized organ or group of cells and carried to another organ or group of cells, in the same organism, upon which it has a specific regulatory function, the term is now commonly used to include non-endogenous, semi-synthetic and fully synthetic analogues of such compounds. hormone Originally referring to an endogenous compound that is formed in specialized organ or group of cells and carried to another organ or group of cells, in the same organism, upon which it has a specific regulatory function, the term is now commonly used to include non-endogenous, semi-synthetic and fully synthetic analogues of such compounds. |
| Application: | vasoconstrictor agent Drug used to cause constriction of the blood vessels. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Ile5-angiotensin II (CHEBI:2719) has role human metabolite (CHEBI:77746) |
| Ile5-angiotensin II (CHEBI:2719) is a angiotensin II (CHEBI:48432) |
| Ile5-angiotensin II (CHEBI:2719) is tautomer of Ile5-angiotensin II dizwitterion (CHEBI:58506) |
| Incoming Relation(s) |
| Ile5-angiotensin II dizwitterion (CHEBI:58506) is tautomer of Ile5-angiotensin II (CHEBI:2719) |
| IUPAC Name |
|---|
| L-α-aspartyl-L-arginyl-L-valyl-L-tyrosyl-L-isoleucyl-L-histidyl-L-prolyl-L-phenylalanine |
| INN | Source |
|---|---|
| angiotensin II | ChemIDplus |
| Synonyms | Source |
|---|---|
| Angiotensin II | KEGG COMPOUND |
| Asp-Arg-Val-Tyr-Ile-His-Pro-Phe | JCBN |
| human angiotensin II | ChemIDplus |
| 5-isoleucine-angiotensin II | ChemIDplus |
| 5-L-isoleucineangiotensin II | ChemIDplus |
| isoleucine5-angiotensin II | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| C02135 | KEGG COMPOUND |
| LSM-42772 | LINCS |
| HMDB0001035 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4289487 | Reaxys |
| CAS:11128-99-7 | KEGG COMPOUND |
| CAS:4474-91-3 | ChemIDplus |
| Citations |
|---|