EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H44O7 |
| Net Charge | 0 |
| Average Mass | 480.642 |
| Monoisotopic Mass | 480.30870 |
| SMILES | [H][C@]1([C@@](C)(O)[C@H](O)CCC(C)(C)O)CC[C@@]2(O)C3=CC(=O)[C@]4([H])C[C@@H](O)[C@@H](O)C[C@]4(C)[C@@]3([H])CC[C@]12C |
| InChI | InChI=1S/C27H44O7/c1-23(2,32)9-8-22(31)26(5,33)21-7-11-27(34)16-12-18(28)17-13-19(29)20(30)14-24(17,3)15(16)6-10-25(21,27)4/h12,15,17,19-22,29-34H,6-11,13-14H2,1-5H3/t15-,17-,19+,20-,21-,22+,24+,25+,26+,27+/m0/s1 |
| InChIKey | NKDFYOWSKOHCCO-YPVLXUMRSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Manduca sexta (ncbitaxon:7130) | - | PubMed (8748375) |
| Roles Classification |
|---|
| Biological Roles: | animal metabolite Any eukaryotic metabolite produced during a metabolic reaction in animals that include diverse creatures from sponges, insects to mammals. antiviral agent A substance that destroys or inhibits replication of viruses. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. hormone Originally referring to an endogenous compound that is formed in specialized organ or group of cells and carried to another organ or group of cells, in the same organism, upon which it has a specific regulatory function, the term is now commonly used to include non-endogenous, semi-synthetic and fully synthetic analogues of such compounds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 20-hydroxyecdysone (CHEBI:16587) has functional parent ecdysone (CHEBI:16688) |
| 20-hydroxyecdysone (CHEBI:16587) has role animal metabolite (CHEBI:75767) |
| 20-hydroxyecdysone (CHEBI:16587) has role antiviral agent (CHEBI:22587) |
| 20-hydroxyecdysone (CHEBI:16587) has role plant metabolite (CHEBI:76924) |
| 20-hydroxyecdysone (CHEBI:16587) is a 14α-hydroxy steroid (CHEBI:36861) |
| 20-hydroxyecdysone (CHEBI:16587) is a 20-hydroxy steroid (CHEBI:36854) |
| 20-hydroxyecdysone (CHEBI:16587) is a 22-hydroxy steroid (CHEBI:36863) |
| 20-hydroxyecdysone (CHEBI:16587) is a 25-hydroxy steroid (CHEBI:36864) |
| 20-hydroxyecdysone (CHEBI:16587) is a 2β-hydroxy steroid (CHEBI:36859) |
| 20-hydroxyecdysone (CHEBI:16587) is a 3β-sterol (CHEBI:35348) |
| 20-hydroxyecdysone (CHEBI:16587) is a ecdysteroid (CHEBI:23897) |
| 20-hydroxyecdysone (CHEBI:16587) is a phytoecdysteroid (CHEBI:26118) |
| IUPAC Name |
|---|
| (22R)-2β,3β,14α,20,22,25-hexahydroxy-5β-cholest-7-en-6-one |
| Synonyms | Source |
|---|---|
| 20-hydroxy-.alpha.-ecdysone | ChEMBL |
| 20-Hydroxyecdysone | KEGG COMPOUND |
| 20-OH ecdysone | ChEBI |
| beta-Ecdysone | ChemIDplus |
| beta-Ecdysterone | ChemIDplus |
| Bio 101 | ChEMBL |
| UniProt Name | Source |
|---|---|
| 20-hydroxyecdysone | UniProt |
| Manual Xrefs | Databases |
|---|---|
| 20E | PDBeChem |
| 20-Hydroxyecdysone | Wikipedia |
| C00003654 | KNApSAcK |
| C02633 | KEGG COMPOUND |
| C02633 | KEGG COMPOUND |
| CPD-276 | MetaCyc |
| HMDB0030180 | HMDB |
| LMST01010209 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1917578 | Reaxys |
| CAS:5289-74-7 | ChemIDplus |
| CAS:5289-74-7 | KEGG COMPOUND |
| Citations |
|---|