EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H15O15P3 |
| Net Charge | 0 |
| Average Mass | 420.093 |
| Monoisotopic Mass | 419.96238 |
| SMILES | O=P(O)(O)O[C@@H]1[C@H](O)[C@H](O)[C@@H](OP(=O)(O)O)[C@H](OP(=O)(O)O)[C@H]1O |
| InChI | InChI=1S/C6H15O15P3/c7-1-2(8)5(20-23(13,14)15)6(21-24(16,17)18)3(9)4(1)19-22(10,11)12/h1-9H,(H2,10,11,12)(H2,13,14,15)(H2,16,17,18)/t1-,2+,3+,4-,5-,6-/m1/s1 |
| InChIKey | MMWCIQZXVOZEGG-XJTPDSDZSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | - | PubMed (19425150) | Source: BioModels - MODEL1507180067 |
| Roles Classification |
|---|
| Biological Role: | mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1D-myo-inositol 1,4,5-trisphosphate (CHEBI:16595) has role mouse metabolite (CHEBI:75771) |
| 1D-myo-inositol 1,4,5-trisphosphate (CHEBI:16595) is a myo-inositol trisphosphate (CHEBI:25450) |
| 1D-myo-inositol 1,4,5-trisphosphate (CHEBI:16595) is conjugate acid of 1D-myo-inositol 1,4,5-trisphosphate(6−) (CHEBI:203600) |
| Incoming Relation(s) |
| D-myo-Ins(1,4,5)P3 hexakis(butyryloxymethyl) ester (CHEBI:138527) has functional parent 1D-myo-inositol 1,4,5-trisphosphate (CHEBI:16595) |
| 1D-myo-inositol 1,4,5-trisphosphate(6−) (CHEBI:203600) is conjugate base of 1D-myo-inositol 1,4,5-trisphosphate (CHEBI:16595) |
| IUPAC Name |
|---|
| 1D-myo-inositol 1,4,5-tris(dihydrogen phosphate) |
| Synonyms | Source |
|---|---|
| 1,4,5-Insp3 | ChemIDplus |
| 1D-myo-Inositol 1,4,5-trisphosphate | KEGG COMPOUND |
| D-MYO-INOSITOL-1,4,5-TRIPHOSPHATE | PDBeChem |
| D-myo-Inositol 1,4,5-trisphosphate | KEGG COMPOUND |
| Inositol 1,4,5-trisphosphate | KEGG COMPOUND |
| Ins(1,4,5)P3 | KEGG COMPOUND |