EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H6O5 |
| Net Charge | 0 |
| Average Mass | 146.098 |
| Monoisotopic Mass | 146.02152 |
| SMILES | O=C1O[C@H](CO)C(O)=C1O |
| InChI | InChI=1S/C5H6O5/c6-1-2-3(7)4(8)5(9)10-2/h2,6-8H,1H2/t2-/m1/s1 |
| InChIKey | ZZZCUOFIHGPKAK-UWTATZPHSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Sclerotinia sclerotiorum (ncbitaxon:5180) | - | PubMed (7612007) |
| Roles Classification |
|---|
| Chemical Role: | antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. |
| Biological Roles: | cofactor An organic molecule or ion (usually a metal ion) that is required by an enzyme for its activity. It may be attached either loosely (coenzyme) or tightly (prosthetic group). fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dehydro-D-arabinono-1,4-lactone (CHEBI:17803) has role antioxidant (CHEBI:22586) |
| dehydro-D-arabinono-1,4-lactone (CHEBI:17803) has role cofactor (CHEBI:23357) |
| dehydro-D-arabinono-1,4-lactone (CHEBI:17803) has role fungal metabolite (CHEBI:76946) |
| dehydro-D-arabinono-1,4-lactone (CHEBI:17803) is a γ-lactone (CHEBI:37581) |
| dehydro-D-arabinono-1,4-lactone (CHEBI:17803) is conjugate acid of dehydro-D-arabinono-1,4-lactone(1−) (CHEBI:58277) |
| Incoming Relation(s) |
| dehydro-D-arabinono-1,4-lactone(1−) (CHEBI:58277) is conjugate base of dehydro-D-arabinono-1,4-lactone (CHEBI:17803) |
| IUPAC Name |
|---|
| (5R)-3,4-dihydroxy-5-(hydroxymethyl)furan-2(5H)-one |
| Synonyms | Source |
|---|---|
| (5R)-3,4-Dihydroxy-5-(hydroxymethyl)furan-2(5H)-one | KEGG COMPOUND |
| D-erythroascorbic acid | ChEBI |
| D-glycero-2-pentenono-l,4-lactone | ChEBI |
| Citations |
|---|