EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C55H92O7P2 |
| Net Charge | 0 |
| Average Mass | 927.282 |
| Monoisotopic Mass | 926.63183 |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/CC/C(C)=C\CC/C(C)=C\CC/C(C)=C\CC/C(C)=C\CC/C(C)=C\CC/C(C)=C\CC/C(C)=C\CC/C(C)=C\COP(=O)(O)OP(=O)(O)O |
| InChI | InChI=1S/C55H92O7P2/c1-45(2)23-13-24-46(3)25-14-26-47(4)27-15-28-48(5)29-16-30-49(6)31-17-32-50(7)33-18-34-51(8)35-19-36-52(9)37-20-38-53(10)39-21-40-54(11)41-22-42-55(12)43-44-61-64(59,60)62-63(56,57)58/h23,25,27,29,31,33,35,37,39,41,43H,13-22,24,26,28,30,32,34,36,38,40,42,44H2,1-12H3,(H,59,60)(H2,56,57,58)/b46-25+,47-27+,48-29-,49-31-,50-33-,51-35-,52-37-,53-39-,54-41-,55-43- |
| InChIKey | NTXGVHCCXVHYCL-NTDVEAECSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Escherichia coli (ncbitaxon:562) | - | PubMed (21988831) |
| Roles Classification |
|---|
| Biological Roles: | Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. Saccharomyces cerevisiae metabolite Any fungal metabolite produced during a metabolic reaction in Baker's yeast (Saccharomyces cerevisiae ). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ditrans,polycis-undecaprenyl diphosphate (CHEBI:18197) has role Escherichia coli metabolite (CHEBI:76971) |
| ditrans,polycis-undecaprenyl diphosphate (CHEBI:18197) is a undecaprenyl diphosphate (CHEBI:53042) |
| ditrans,polycis-undecaprenyl diphosphate (CHEBI:18197) is conjugate acid of ditrans,polycis-undecaprenyl diphosphate(3−) (CHEBI:58405) |
| Incoming Relation(s) |
| ditrans,polycis-undecaprenyl diphosphate(3−) (CHEBI:58405) is conjugate base of ditrans,polycis-undecaprenyl diphosphate (CHEBI:18197) |
| IUPAC Name |
|---|
| (2Z,6Z,10Z,14Z,18Z,22Z,26Z,30Z,34E,38E)-3,7,11,15,19,23,27,31,35,39,43-undecamethyltetratetraconta-2,6,10,14,18,22,26,30,34,38,42-undecaen-1-yl trihydrogen diphosphate |
| Synonyms | Source |
|---|---|
| Bactoprenyl diphosphate | KEGG COMPOUND |
| di-trans,poly-cis-undecaprenyl diphosphate | ChEBI |
| di-trans,poly-cis-Undecaprenyl diphosphate | KEGG COMPOUND |
| di-trans,poly-cis-undecaprenyl diphosphate | ChEBI |
| ditrans,polycis-undecaprenyl diphosphate | JCBN |
| Undecaprenyl diphosphate | KEGG COMPOUND |