EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H18N2O3 |
| Net Charge | 0 |
| Average Mass | 250.298 |
| Monoisotopic Mass | 250.13174 |
| SMILES | NCCCCNC(=O)/C=C/c1ccc(O)c(O)c1 |
| InChI | InChI=1S/C13H18N2O3/c14-7-1-2-8-15-13(18)6-4-10-3-5-11(16)12(17)9-10/h3-6,9,16-17H,1-2,7-8,14H2,(H,15,18)/b6-4+ |
| InChIKey | KTZNZCYTXQYEHT-GQCTYLIASA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-caffeoylputrescine (CHEBI:17417) is a N-substituted putrescine (CHEBI:26406) |
| N-caffeoylputrescine (CHEBI:17417) is conjugate base of N-caffeoylputrescinium(1+) (CHEBI:58138) |
| Incoming Relation(s) |
| N-caffeoylputrescine glycoside (CHEBI:142426) has functional parent N-caffeoylputrescine (CHEBI:17417) |
| N-caffeoylputrescinium(1+) (CHEBI:58138) is conjugate acid of N-caffeoylputrescine (CHEBI:17417) |
| IUPAC Name |
|---|
| (2E)-N-(4-aminobutyl)-3-(3,4-dihydroxyphenyl)prop-2-enamide |
| Synonyms | Source |
|---|---|
| N-Caffeoylputrescine | KEGG COMPOUND |
| (2E)-N-(4-aminobutyl)-3-(3,4-dihydroxyphenyl)acrylamide | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C00002719 | KNApSAcK |