EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H8O5 |
| Net Charge | 0 |
| Average Mass | 160.125 |
| Monoisotopic Mass | 160.03717 |
| SMILES | O=C(O)CCCC(=O)C(=O)O |
| InChI | InChI=1S/C6H8O5/c7-4(6(10)11)2-1-3-5(8)9/h1-3H2,(H,8,9)(H,10,11) |
| InChIKey | FGSBNBBHOZHUBO-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Glycine max (ncbitaxon:3847) | - | MetaboLights (MTBLS117) | From MetaboLights |
| Homo sapiens (ncbitaxon:9606) | urine (BTO:0001419) | PubMed (8087979) | |
| Mus musculus (ncbitaxon:10090) | - | PubMed (19425150) | Source: BioModels - MODEL1507180067 |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | human urinary metabolite Any metabolite (endogenous or exogenous) found in human urine samples. mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-oxoadipic acid (CHEBI:15753) has functional parent adipic acid (CHEBI:30832) |
| 2-oxoadipic acid (CHEBI:15753) has role human urinary metabolite (CHEBI:84087) |
| 2-oxoadipic acid (CHEBI:15753) has role mouse metabolite (CHEBI:75771) |
| 2-oxoadipic acid (CHEBI:15753) is a oxo dicarboxylic acid (CHEBI:36145) |
| 2-oxoadipic acid (CHEBI:15753) is conjugate acid of 2-oxoadipate(2−) (CHEBI:57499) |
| Incoming Relation(s) |
| 2-oxoadipate(2−) (CHEBI:57499) is conjugate base of 2-oxoadipic acid (CHEBI:15753) |
| IUPAC Name |
|---|
| 2-oxohexanedioic acid |
| Synonyms | Source |
|---|---|
| 2-ketoadipic acid | HMDB |
| 2-Oxoadipic acid | KEGG COMPOUND |
| 2-oxo-hexanedioic acid | ChemIDplus |
| α-ketoadipic acid | ChemIDplus |
| α-oxoadipic acid | HMDB |
| Manual Xrefs | Databases |
|---|---|
| 70 | ChemSpider |
| Alpha-Ketoadipic_acid | Wikipedia |
| C00000770 | KNApSAcK |
| C00322 | KEGG COMPOUND |
| FDB003362 | FooDB |
| HMDB0000225 | HMDB |
| LMFA01170121 | LIPID MAPS |
| OOG | PDBeChem |
| Citations |
|---|