EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H24O2 |
| Net Charge | 0 |
| Average Mass | 236.355 |
| Monoisotopic Mass | 236.17763 |
| SMILES | [H]C(=O)O/C=C(\C)CCC1=C(C)CCCC1(C)C |
| InChI | InChI=1S/C15H24O2/c1-12(10-17-11-16)7-8-14-13(2)6-5-9-15(14,3)4/h10-11H,5-9H2,1-4H3/b12-10+ |
| InChIKey | MJURCEOLOMHLAX-ZRDIBKRKSA-N |
| Roles Classification |
|---|
| Chemical Role: | luciferin A low-molecular-mass compound present in bioluminescent organisms that emits light when oxidized in presence of enzyme luciferase. |
| Biological Roles: | luciferin A low-molecular-mass compound present in bioluminescent organisms that emits light when oxidized in presence of enzyme luciferase. animal metabolite Any eukaryotic metabolite produced during a metabolic reaction in animals that include diverse creatures from sponges, insects to mammals. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Latia luciferin (CHEBI:17269) has role animal metabolite (CHEBI:75767) |
| Latia luciferin (CHEBI:17269) has role luciferin (CHEBI:25078) |
| Latia luciferin (CHEBI:17269) is a apo carotenoid sesquiterpenoid (CHEBI:36758) |
| Latia luciferin (CHEBI:17269) is a formate ester (CHEBI:52343) |
| Incoming Relation(s) |
| oxidized Latia luciferin (CHEBI:18015) is a Latia luciferin (CHEBI:17269) |
| IUPAC Name |
|---|
| (1E)-2-methyl-4-(2,6,6-trimethylcyclohex-1-en-1-yl)but-1-enyl formate |
| Synonyms | Source |
|---|---|
| (9E)-7,8-dihydro-10-apo-β-caroten-10-yl formate | JCBN |
| Latia luciferin | KEGG COMPOUND |
| latiluciferin | ChEBI |
| UniProt Name | Source |
|---|---|
| Latia luciferin | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C02293 | KEGG COMPOUND |
| C02293 | KEGG COMPOUND |
| LATIA-LUCIFERIN | MetaCyc |
| LMPR0103050003 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1876844 | Reaxys |
| CAS:21730-91-6 | KEGG COMPOUND |
| Citations |
|---|