EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H11NO3 |
| Net Charge | 0 |
| Average Mass | 217.224 |
| Monoisotopic Mass | 217.07389 |
| SMILES | C[C@H](C(=O)C(=O)O)c1cnc2ccccc12 |
| InChI | InChI=1S/C12H11NO3/c1-7(11(14)12(15)16)9-6-13-10-5-3-2-4-8(9)10/h2-7,13H,1H3,(H,15,16)/t7-/m0/s1 |
| InChIKey | VSANSNPZLCXLRK-ZETCQYMHSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (S)-3-(indol-3-yl)-2-oxobutyric acid (CHEBI:16083) is a 3-(indol-3-yl)-2-oxobutyric acid (CHEBI:28549) |
| (S)-3-(indol-3-yl)-2-oxobutyric acid (CHEBI:16083) is conjugate acid of (S)-3-(indol-3-yl)-2-oxobutyrate (CHEBI:57633) |
| (S)-3-(indol-3-yl)-2-oxobutyric acid (CHEBI:16083) is enantiomer of (R)-3-(indol-3-yl)-2-oxobutyric acid (CHEBI:112106) |
| Incoming Relation(s) |
| (S)-3-(indol-3-yl)-2-oxobutyrate (CHEBI:57633) is conjugate base of (S)-3-(indol-3-yl)-2-oxobutyric acid (CHEBI:16083) |
| (R)-3-(indol-3-yl)-2-oxobutyric acid (CHEBI:112106) is enantiomer of (S)-3-(indol-3-yl)-2-oxobutyric acid (CHEBI:16083) |
| IUPAC Name |
|---|
| (3S)-3-(1H-indol-3-yl)-2-oxobutanoic acid |
| Synonyms | Source |
|---|---|
| (S)-β-methylindolepyruvic acid | ChEBI |
| (S)-beta-Methylindolepyruvate | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| Beilstein:477499 | Beilstein |