EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H9N |
| Net Charge | 0 |
| Average Mass | 143.189 |
| Monoisotopic Mass | 143.07350 |
| SMILES | Nc1ccc2ccccc2c1 |
| InChI | InChI=1S/C10H9N/c11-10-6-5-8-3-1-2-4-9(8)7-10/h1-7H,11H2 |
| InChIKey | JBIJLHTVPXGSAM-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | carcinogenic agent A role played by a chemical compound which is known to induce a process of carcinogenesis by corrupting normal cellular pathways, leading to the acquistion of tumoral capabilities. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-naphthylamine (CHEBI:27878) has role carcinogenic agent (CHEBI:50903) |
| 2-naphthylamine (CHEBI:27878) is a naphthylamine (CHEBI:50448) |
| Incoming Relation(s) |
| N-(2-naphthyl)carboxamide (CHEBI:88330) has functional parent 2-naphthylamine (CHEBI:27878) |
| IUPAC Name |
|---|
| naphthalen-2-amine |
| Synonyms | Source |
|---|---|
| 2-Aminonaphthalene | KEGG COMPOUND |
| 2-naftilamina | ChEBI |
| 2-Naphthalenamine | KEGG COMPOUND |
| 2-Naphthylamin | ChemIDplus |
| 2-Naphthylamine | KEGG COMPOUND |
| 6-naphthylamine | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 2-Naphthylamine | Wikipedia |
| C02227 | KEGG COMPOUND |
| HMDB0041802 | HMDB |
| Citations |
|---|