EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H19NO6 |
| Net Charge | 0 |
| Average Mass | 369.373 |
| Monoisotopic Mass | 369.12124 |
| SMILES | CN1Cc2c(ccc3c2OCO3)CC(=O)c2cc3c(cc2CC1O)OCO3 |
| InChI | InChI=1S/C20H19NO6/c1-21-8-14-11(2-3-16-20(14)27-10-24-16)4-15(22)13-7-18-17(25-9-26-18)5-12(13)6-19(21)23/h2-3,5,7,19,23H,4,6,8-10H2,1H3 |
| InChIKey | QRZCXUNTBXMAPR-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 6-hydroxyprotopine (CHEBI:17104) has functional parent protopine (CHEBI:16415) |
| 6-hydroxyprotopine (CHEBI:17104) is a dibenzazecine alkaloid (CHEBI:38608) |
| 6-hydroxyprotopine (CHEBI:17104) is a hemiaminal (CHEBI:73080) |
| 6-hydroxyprotopine (CHEBI:17104) is a tertiary amino compound (CHEBI:50996) |
| IUPAC Name |
|---|
| 6-hydroxy-7-methyl-2,3:9,10-bis[methylenebis(oxy)]-7,13a-secoberbin-13a-one |
| Synonyms | Source |
|---|---|
| 10-hydroxyprotopine | IUBMB |
| 6-Hydroxyprotopine | KEGG COMPOUND |
| 8-hydroxy-7-methyl-6,8,9,16-tetrahydrobis[1,3]benzodioxolo[4,5-c:5',6'-g]azecin-15(7H)-one | ChEBI |
| UniProt Name | Source |
|---|---|
| 6-hydroxyprotopine | UniProt |