EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:15924 - 5-oxopent-3-ene-1,2,5-tricarboxylic acid
| Formula | C8H8O7 |
| Net Charge | 0 |
| Average Mass | 216.145 |
| Monoisotopic Mass | 216.02700 |
| SMILES | [H]C(=CC(=O)C(=O)O)C(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C8H8O7/c9-5(8(14)15)2-1-4(7(12)13)3-6(10)11/h1-2,4H,3H2,(H,10,11)(H,12,13)(H,14,15) |
| InChIKey | WHGVLEMQINVDLH-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5-oxopent-3-ene-1,2,5-tricarboxylic acid (CHEBI:15924) is a tricarboxylic acid (CHEBI:27093) |
| Incoming Relation(s) |
| (3E)-5-oxopent-3-ene-1,2,5-tricarboxylic acid (CHEBI:47963) is a 5-oxopent-3-ene-1,2,5-tricarboxylic acid (CHEBI:15924) |
| IUPAC Name |
|---|
| 5-oxopent-3-ene-1,2,5-tricarboxylic acid |
| Synonyms | Source |
|---|---|
| 5-Carboxy-2-oxohept-3-enedioate | KEGG COMPOUND |
| 5-Oxopent-3-ene-1,2,5-tricarboxylate | KEGG COMPOUND |