EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H10N2O3 |
| Net Charge | 0 |
| Average Mass | 158.157 |
| Monoisotopic Mass | 158.06914 |
| SMILES | C=C(C[C@H](N)C(=O)O)C(N)=O |
| InChI | InChI=1S/C6H10N2O3/c1-3(5(8)9)2-4(7)6(10)11/h4H,1-2,7H2,(H2,8,9)(H,10,11)/t4-/m0/s1 |
| InChIKey | CEVQXWMPODOBRM-BYPYZUCNSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-methylene-L-glutamine (CHEBI:16747) is a non-proteinogenic L-α-amino acid (CHEBI:83822) |
| 4-methylene-L-glutamine (CHEBI:16747) is tautomer of 4-methylene-L-glutamine zwitterion (CHEBI:57879) |
| Incoming Relation(s) |
| 4-methylene-L-glutamine zwitterion (CHEBI:57879) is tautomer of 4-methylene-L-glutamine (CHEBI:16747) |
| IUPAC Names |
|---|
| 4-methylidene-L-glutamine |
| (2S)-2-amino-4-carbamoylpent-4-enoic acid |
| Synonym | Source |
|---|---|
| 4-Methylene-L-glutamine | KEGG COMPOUND |