EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C3H7NO4S |
| Net Charge | 0 |
| Average Mass | 153.159 |
| Monoisotopic Mass | 153.00958 |
| SMILES | N[C@@H](CS(=O)O)C(=O)O |
| InChI | InChI=1S/C3H7NO4S/c4-2(3(5)6)1-9(7)8/h2H,1,4H2,(H,5,6)(H,7,8)/t2-/m0/s1 |
| InChIKey | ADVPTQAUNPRNPO-REOHCLBHSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Escherichia coli (ncbitaxon:562) | - | PubMed (21988831) | |
| Mus musculus (ncbitaxon:10090) | - | PubMed (19425150) | Source: BioModels - MODEL1507180067 |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. metabotropic glutamate receptor agonist An agonist that selectively binds to and activates a metabotropic glutamate receptor. human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-sulfino-L-alanine (CHEBI:16345) has role Escherichia coli metabolite (CHEBI:76971) |
| 3-sulfino-L-alanine (CHEBI:16345) has role human metabolite (CHEBI:77746) |
| 3-sulfino-L-alanine (CHEBI:16345) has role metabotropic glutamate receptor agonist (CHEBI:61966) |
| 3-sulfino-L-alanine (CHEBI:16345) has role mouse metabolite (CHEBI:75771) |
| 3-sulfino-L-alanine (CHEBI:16345) is a S-substituted L-cysteine (CHEBI:47910) |
| 3-sulfino-L-alanine (CHEBI:16345) is a organosulfinic acid (CHEBI:37783) |
| 3-sulfino-L-alanine (CHEBI:16345) is conjugate acid of 3-sulfino-L-alanine(1−) (CHEBI:61085) |
| 3-sulfino-L-alanine (CHEBI:16345) is tautomer of L-cysteine-S-dioxide (CHEBI:41721) |
| Incoming Relation(s) |
| 3-sulfino-L-alanine(1−) (CHEBI:61085) is conjugate base of 3-sulfino-L-alanine (CHEBI:16345) |
| 3-sulfino-L-alanine residue (CHEBI:61967) is substituent group from 3-sulfino-L-alanine (CHEBI:16345) |
| L-cysteine-S-dioxide (CHEBI:41721) is tautomer of 3-sulfino-L-alanine (CHEBI:16345) |
| IUPAC Name |
|---|
| 3-sulfino-L-alanine |
| Synonyms | Source |
|---|---|
| (2R)-2-amino-3-sulfinopropanoic acid | IUPAC |
| 3-Sulfinoalanine | KEGG COMPOUND |
| 3-SULFINOALANINE | PDBeChem |
| 3-Sulfino-L-alanine | KEGG COMPOUND |
| 3-Sulphino-L-alanine | KEGG COMPOUND |
| L-Cysteinesulfinic acid | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C00606 | KEGG COMPOUND |
| CSD | PDBeChem |
| Cysteine_sulfinic_acid | Wikipedia |
| DB02153 | DrugBank |
| HMDB0000996 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1724100 | Reaxys |
| CAS:1115-65-7 | KEGG COMPOUND |
| CAS:1115-65-7 | ChemIDplus |
| Citations |
|---|