EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C4H8O2 |
| Net Charge | 0 |
| Average Mass | 88.106 |
| Monoisotopic Mass | 88.05243 |
| SMILES | CC(=O)C(C)O |
| InChI | InChI=1S/C4H8O2/c1-3(5)4(2)6/h3,5H,1-2H3 |
| InChIKey | ROWKJAVDOGWPAT-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| acetoin (CHEBI:15688) has role metabolite (CHEBI:25212) |
| acetoin (CHEBI:15688) is a methyl ketone (CHEBI:51867) |
| acetoin (CHEBI:15688) is a secondary α-hydroxy ketone (CHEBI:2468) |
| Incoming Relation(s) |
| (R)-acetoin (CHEBI:15686) is a acetoin (CHEBI:15688) |
| (S)-acetoin (CHEBI:15687) is a acetoin (CHEBI:15688) |
| IUPAC Name |
|---|
| 3-hydroxybutan-2-one |
| Synonyms | Source |
|---|---|
| Acetoin | KEGG COMPOUND |
| 2-Acetoin | KEGG COMPOUND |
| 3-Hydroxybutan-2-one | KEGG COMPOUND |
| 3-Hydroxy-2-butanone | KEGG COMPOUND |
| Dimethylketol | KEGG COMPOUND |
| 1-Hydroxyethyl methyl ketone | ChemIDplus |
| UniProt Name | Source |
|---|---|
| acetoin | UniProt |