EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
We are looking for a new Chemistry curator to join the ChEBI team. Find out more about it here.
CHEBI:16943 - (R)-2,4-dihydroxy-3-oxobutanoic acid
| Formula | C4H6O5 |
| Net Charge | 0 |
| Average Mass | 134.087 |
| Monoisotopic Mass | 134.02152 |
| SMILES | O=C(O)[C@H](O)C(=O)CO |
| InChI | InChI=1S/C4H6O5/c5-1-2(6)3(7)4(8)9/h3,5,7H,1H2,(H,8,9)/t3-/m1/s1 |
| InChIKey | SCSGVVIUUUPOOJ-GSVOUGTGSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (R)-2,4-dihydroxy-3-oxobutanoic acid (CHEBI:16943) has functional parent L-threonic acid (CHEBI:15908) |
| (R)-2,4-dihydroxy-3-oxobutanoic acid (CHEBI:16943) is a 3-oxo monocarboxylic acid (CHEBI:47881) |
| (R)-2,4-dihydroxy-3-oxobutanoic acid (CHEBI:16943) is a dihydroxy monocarboxylic acid (CHEBI:35972) |
| (R)-2,4-dihydroxy-3-oxobutanoic acid (CHEBI:16943) is a ketoaldonic acid (CHEBI:24963) |
| (R)-2,4-dihydroxy-3-oxobutanoic acid (CHEBI:16943) is conjugate acid of (R)-2,4-dihydroxy-3-oxobutanoate (CHEBI:57958) |
| (R)-2,4-dihydroxy-3-oxobutanoic acid (CHEBI:16943) is enantiomer of (S)-2,4-dihydroxy-3-oxobutanoic acid (CHEBI:137502) |
| Incoming Relation(s) |
| (R)-2,4-dihydroxy-3-oxobutanoate (CHEBI:57958) is conjugate base of (R)-2,4-dihydroxy-3-oxobutanoic acid (CHEBI:16943) |
| (S)-2,4-dihydroxy-3-oxobutanoic acid (CHEBI:137502) is enantiomer of (R)-2,4-dihydroxy-3-oxobutanoic acid (CHEBI:16943) |
| IUPAC Name |
|---|
| (2R)-2,4-dihydroxy-3-oxobutanoic acid |
| Synonyms | Source |
|---|---|
| 3-dehydro-L-threonate | ChEBI |
| 3-Dehydro-L-threonate | KEGG COMPOUND |