EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H24O7 |
| Net Charge | 0 |
| Average Mass | 364.394 |
| Monoisotopic Mass | 364.15220 |
| SMILES | [H][C@@]12CC[C@]3(O)C[C@]1(CC3=C)[C@@H](C(=O)O)[C@@]1([H])[C@@]23C[C@H](O)[C@H](O)[C@@]1(C)C(=O)O3 |
| InChI | InChI=1S/C19H24O7/c1-8-5-17-7-18(8,25)4-3-10(17)19-6-9(20)13(21)16(2,15(24)26-19)12(19)11(17)14(22)23/h9-13,20-21,25H,1,3-7H2,2H3,(H,22,23)/t9-,10+,11+,12+,13-,16-,17-,18-,19+/m0/s1 |
| InChIKey | WZRRJZYYGOOHRC-UQJCXHNCSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. plant hormone A plant growth regulator that modulates the formation of stems, leaves and flowers, as well as the development and ripening of fruit. The term includes endogenous and non-endogenous compounds (e.g. active compounds produced by bacteria on the leaf surface) as well as semi-synthetic and fully synthetic compounds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| gibberellin A8 (CHEBI:28861) has role plant metabolite (CHEBI:76924) |
| gibberellin A8 (CHEBI:28861) is a C19-gibberellin (CHEBI:20858) |
| gibberellin A8 (CHEBI:28861) is a gibberellin monocarboxylic acid (CHEBI:38305) |
| gibberellin A8 (CHEBI:28861) is a lactone (CHEBI:25000) |
| gibberellin A8 (CHEBI:28861) is conjugate acid of gibberellin A8(1−) (CHEBI:58594) |
| Incoming Relation(s) |
| gibberellin A8-catabolite (CHEBI:29604) has functional parent gibberellin A8 (CHEBI:28861) |
| gibberellin A8(1−) (CHEBI:58594) is conjugate base of gibberellin A8 (CHEBI:28861) |
| IUPAC Names |
|---|
| (1R,2R,5S,8S,9S,10R,11S,12R,13S)-5,12,13-trihydroxy-11-methyl-6-methylidene-16-oxo-15-oxapentacyclo[9.3.2.15,8.01,10.02,8]heptadecane-9-carboxylic acid |
| 2β,3β,7α-trihydroxy-1β-methyl-8-methylidene-13-oxo-4a,1α-epoxymethano-4aα,4bβ-gibbane-10β-carboxylic acid |
| Synonyms | Source |
|---|---|
| 2beta-Hydroxygibberellin 1 | KEGG COMPOUND |
| 2beta-Hydroxygibberellin 1 | KEGG COMPOUND |
| 3β-hydroxygibberellin A1 | ChEBI |
| GA8 | ChEBI |
| gibberellin 8 | ChEBI |
| Gibberellin A8 | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C00000008 | KNApSAcK |
| C03579 | KEGG COMPOUND |
| C03579 | KEGG COMPOUND |
| LMPR0104170005 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8809026 | Reaxys |
| CAS:7044-72-6 | ChemIDplus |
| CAS:7044-72-6 | KEGG COMPOUND |
| Citations |
|---|