EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H24O3 |
| Net Charge | 0 |
| Average Mass | 288.387 |
| Monoisotopic Mass | 288.17254 |
| SMILES | [H][C@@]12CCc3cc(O)c(O)cc3[C@@]1([H])CC[C@]1(C)[C@@H](O)CC[C@@]21[H] |
| InChI | InChI=1S/C18H24O3/c1-18-7-6-11-12(14(18)4-5-17(18)21)3-2-10-8-15(19)16(20)9-13(10)11/h8-9,11-12,14,17,19-21H,2-7H2,1H3/t11-,12+,14-,17-,18-/m0/s1 |
| InChIKey | DILDHNKDVHLEQB-XSSYPUMDSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | DOI (10.1038/nbt.2488) | |
| Mus musculus (ncbitaxon:10090) | - | PubMed (19425150) | Source: BioModels - MODEL1507180067 |
| Roles Classification |
|---|
| Biological Roles: | carcinogenic agent A role played by a chemical compound which is known to induce a process of carcinogenesis by corrupting normal cellular pathways, leading to the acquistion of tumoral capabilities. mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | prodrug A compound that, on administration, must undergo chemical conversion by metabolic processes before becoming the pharmacologically active drug for which it is a prodrug. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-hydroxy-17β-estradiol (CHEBI:28744) has functional parent 17β-estradiol (CHEBI:16469) |
| 2-hydroxy-17β-estradiol (CHEBI:28744) has role carcinogenic agent (CHEBI:50903) |
| 2-hydroxy-17β-estradiol (CHEBI:28744) has role human metabolite (CHEBI:77746) |
| 2-hydroxy-17β-estradiol (CHEBI:28744) has role metabolite (CHEBI:25212) |
| 2-hydroxy-17β-estradiol (CHEBI:28744) has role mouse metabolite (CHEBI:75771) |
| 2-hydroxy-17β-estradiol (CHEBI:28744) has role prodrug (CHEBI:50266) |
| 2-hydroxy-17β-estradiol (CHEBI:28744) is a 17β-hydroxy steroid (CHEBI:35343) |
| 2-hydroxy-17β-estradiol (CHEBI:28744) is a 2-hydroxy steroid (CHEBI:36857) |
| Incoming Relation(s) |
| 2-hydroxy-17β-estradiol 2-O-(β-D-glucuronide) (CHEBI:137907) has functional parent 2-hydroxy-17β-estradiol (CHEBI:28744) |
| 2-hydroxy-17β-estradiol 3-O-(β-D-glucuronide) (CHEBI:137837) has functional parent 2-hydroxy-17β-estradiol (CHEBI:28744) |
| 2-hydroxy-17β-estradiol 3-sulfate (CHEBI:136585) has functional parent 2-hydroxy-17β-estradiol (CHEBI:28744) |
| 2-hydroxy-17β-estradiol 3-sulfate(1−) (CHEBI:133942) has functional parent 2-hydroxy-17β-estradiol (CHEBI:28744) |
| IUPAC Name |
|---|
| estra-1,3,5(10)-triene-2,3,17β-triol |
| Synonyms | Source |
|---|---|
| (17β)-estra-1,3,5(10)-triene-2,3,17-triol | ChemIDplus |
| 2-Hydroxyestradiol-17beta | KEGG COMPOUND |
| 2-Hydroxyestradiol-17beta | KEGG COMPOUND |
| 2-OH-E2 | ChemIDplus |
| 2-OH-estradiol | ChemIDplus |
| 2-OH-Estradiol | KEGG COMPOUND |
| UniProt Name | Source |
|---|---|
| 2-hydroxy-17β-estradiol | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C05301 | KEGG COMPOUND |
| C05301 | KEGG COMPOUND |
| DB07706 | DrugBank |
| LMST02010027 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2219367 | Reaxys |
| CAS:362-05-0 | ChemIDplus |
| CAS:362-05-0 | KEGG COMPOUND |
| Citations |
|---|