EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H14O6 |
| Net Charge | 0 |
| Average Mass | 194.183 |
| Monoisotopic Mass | 194.07904 |
| SMILES | CO[C@@H]1[C@@H](O)[C@H](O)[C@@H](O)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C7H14O6/c1-13-7-5(11)3(9)2(8)4(10)6(7)12/h2-12H,1H3/t2-,3-,4+,5-,6-,7-/m0/s1 |
| InChIKey | DSCFFEYYQKSRSV-ABXOWTNVSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Eysenhardtia platycarpa (ncbitaxon:252459) | branch (BTO:0000148) | PubMed (17190443) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1D-3-O-methyl-myo-inositol (CHEBI:28310) has role plant metabolite (CHEBI:76924) |
| 1D-3-O-methyl-myo-inositol (CHEBI:28310) is a methyl myo-inositols (CHEBI:25270) |
| IUPAC Name |
|---|
| 1D-3-O-methyl-myo-inositol |
| Synonyms | Source |
|---|---|
| 3-O-Methyl-myo-inositol | KEGG COMPOUND |
| 1D-3-O-Methyl-myo-inositol | KEGG COMPOUND |
| (1S,2R,3R,4S,5S,6R)-6-methoxycyclohexane-1,2,3,4,5-pentol | IUPAC |
| UniProt Name | Source |
|---|---|
| 1D-3-O-methyl-myo-inositol | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C03660 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2043790 | Reaxys |
| Citations |
|---|