EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C41H32O26 |
| Net Charge | 0 |
| Average Mass | 940.681 |
| Monoisotopic Mass | 940.11818 |
| SMILES | O=C(OC[C@H]1O[C@@H](OC(=O)c2cc(O)c(O)c(O)c2)[C@H](OC(=O)c2cc(O)c(O)c(O)c2)[C@@H](OC(=O)c2cc(O)c(O)c(O)c2)[C@@H]1OC(=O)c1cc(O)c(O)c(O)c1)c1cc(O)c(O)c(O)c1 |
| InChI | InChI=1S/C41H32O26/c42-17-1-12(2-18(43)28(17)52)36(57)62-11-27-33(64-37(58)13-3-19(44)29(53)20(45)4-13)34(65-38(59)14-5-21(46)30(54)22(47)6-14)35(66-39(60)15-7-23(48)31(55)24(49)8-15)41(63-27)67-40(61)16-9-25(50)32(56)26(51)10-16/h1-10,27,33-35,41-56H,11H2/t27-,33-,34+,35-,41+/m1/s1 |
| InChIKey | QJYNZEYHSMRWBK-NIKIMHBISA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Acer truncatum (ncbitaxon:47965) | leaf (BTO:0000713) | PubMed (17141590) | |
| Juglans mandshurica (ncbitaxon:91218) | bark (BTO:0001301) | PubMed (19576177) | |
| Paeonia lactiflora (ncbitaxon:35924) | Root (BTO:0001188) | PubMed (17015965) | |
| Paeonia suffruticosa (ncbitaxon:45171) | - | PubMed (19457098) | |
| Pelargonium inquinans (ncbitaxon:158598) | - | PubMed (18386256) | |
| Terminalia chebula (ncbitaxon:155022) | fruit (BTO:0000486) | PubMed (20369791) |
| Roles Classification |
|---|
| Chemical Role: | radical scavenger A role played by a substance that can react readily with, and thereby eliminate, radicals. |
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Applications: | radiation protective agent Any compound that is able to protect normal cells from the damage caused by radiation therapy. anti-inflammatory agent Any compound that has anti-inflammatory effects. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. hepatoprotective agent Any compound that is able to prevent damage to the liver. geroprotector Any compound that supports healthy aging, slows the biological aging process, or extends lifespan. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1,2,3,4,6-pentakis-O-galloyl-β-D-glucose (CHEBI:18082) has role anti-inflammatory agent (CHEBI:67079) |
| 1,2,3,4,6-pentakis-O-galloyl-β-D-glucose (CHEBI:18082) has role antineoplastic agent (CHEBI:35610) |
| 1,2,3,4,6-pentakis-O-galloyl-β-D-glucose (CHEBI:18082) has role geroprotector (CHEBI:176497) |
| 1,2,3,4,6-pentakis-O-galloyl-β-D-glucose (CHEBI:18082) has role hepatoprotective agent (CHEBI:62868) |
| 1,2,3,4,6-pentakis-O-galloyl-β-D-glucose (CHEBI:18082) has role plant metabolite (CHEBI:76924) |
| 1,2,3,4,6-pentakis-O-galloyl-β-D-glucose (CHEBI:18082) has role radiation protective agent (CHEBI:66987) |
| 1,2,3,4,6-pentakis-O-galloyl-β-D-glucose (CHEBI:18082) has role radical scavenger (CHEBI:48578) |
| 1,2,3,4,6-pentakis-O-galloyl-β-D-glucose (CHEBI:18082) is a gallate ester (CHEBI:37576) |
| 1,2,3,4,6-pentakis-O-galloyl-β-D-glucose (CHEBI:18082) is a galloyl β-D-glucose (CHEBI:24183) |
| 1,2,3,4,6-pentakis-O-galloyl-β-D-glucose (CHEBI:18082) is conjugate acid of 1,2,3,4,6-pentakis-O-galloyl-β-D-glucose(1−) (CHEBI:145902) |
| Incoming Relation(s) |
| 1,2,3,4,6-pentakis-O-galloyl-β-D-glucose(1−) (CHEBI:145902) is conjugate base of 1,2,3,4,6-pentakis-O-galloyl-β-D-glucose (CHEBI:18082) |
| IUPAC Name |
|---|
| 1,2,3,4,6-pentakis-O-(3,4,5-trihydroxybenzoyl)-β-D-glucopyranose |
| Synonyms | Source |
|---|---|
| 1,2,3,4,6-penta-O-galloyl-β-D-glucopyranose | ChEBI |
| 1,2,3,4,6-penta-O-galloyl-β-D-glucopyranoside | ChEBI |
| 1,2,3,4,6-penta-O-galloyl-β-D-glucose | ChEBI |
| 1,2,3,4,6-penta-O-galloyl-β-D-glucoside | ChEBI |
| 1,2,3,4,6-pentagalloyl-β-D-glucopyranose | ChEBI |
| 1,2,3,4,6-pentagalloyl-β-D-glucopyranoside | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 12346-PENTAKIS-O-GALLOYL-BETA-D-GLUC | MetaCyc |
| 58735 | ChemSpider |
| C00002933 | KNApSAcK |
| C04576 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| Beilstein:79674 | Beilstein |
| CAS:14937-32-7 | ChemIDplus |
| CAS:14937-32-7 | KEGG COMPOUND |
| Citations |
|---|